Đáp án và lời giải đề thi thử THPT QG 2019 môn hóa học THPT chuyên lê hồng phong nam định lần 1 file word có ma trận lời giải chi tiết www hoctai vn

4 37 0
  • Loading ...
1/4 trang

Thông tin tài liệu

Ngày đăng: 15/12/2019, 21:40

SỞ GIÁO DỤC VÀ ĐÀO TẠO TỈNH NAM ĐỊNH TRƯỜNG THPT CHUYÊN LÊ HỒNG PHONG ĐỀ THI THỬ THPT QUỐC GIA NĂM 2019 LẦN Mơn thi thành phần: HĨA HỌC Thời gian làm bài: 50 phút, không kể thời gian phát đề (Đề thi có 40 câu / trang) ĐỀ CHÍNH THỨC Mã đề: 132 Cho biết nguyên tử khối nguyên tố: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr = 52; Fe = 56; Cu = 64; Zn = 65; Ag = 108; Ba = 137 I CẤU TRÚC ĐỀ: Lớp 12 11 10 MỤC LỤC Este – lipit Cacbohidrat Amin – Aminoaxit - Protein Polime vật liệu Đại cương kim loại Kiềm – Kiềm thổ - Nhôm Crom – Sắt Phân biệt nhận biết Hố học thực tiễn Thực hành thí nghiệm Điện li Nitơ – Photpho – Phân bón Cacbon - Silic Đại cương - Hiđrocacbon Ancol – Anđehit – Axit Kiến thức lớp 10 Tổng hợp hố vơ Tổng hợp hố hữu Nhận biết Thơng hiểu 2 Vận dụng thấp 1 Vận dụng cao 1 TỔNG 5 0 1 4 1 4 II ĐÁNH GIÁ – NHẬN XÉT: - Cấu trúc: 60% lý thuyết (24 câu) + 40% tập (16 câu) - Nội dung: + Đề thi phân bố cho chương trình lớp (đề thi minh hoạ khơng có lớp 10) + Ở mảng vơ cơ: Mảng tập khó vơ thường rơi vào dạng toán hợp chất khử tác dụng H+ NO3- + Ở mảng hữu cơ: Mảng tập khó hữu thường rơi vào dạng tốn biện luận este, amin, aminoaxit, muối amoni peptit + Đề phân hóa rõ ràng mức độ nhận biết, thông hiểu, vận dụng thấp, vận dụng cao III ĐÁP ÁN THAM KHẢO: PHẦN ĐÁP ÁN 41A 51D 61B 71D 42D 52C 62B 72C 43B 53C 63A 73D 44B 54B 64B 74B 45D 55C 65A 75A 46C 56B 66A 76C 47D 57D 67B 77C 48A 58D 68C 78C 49B 59D 69D 79A 50C 60A 70A 80A HƯỚNG DẪN GIẢI CHI TIẾT Câu 55 Chọn C Ta có: moxit = mrắn + mO  n O = n CO2 = n CaCO3 = 0, 09 mol  mCaCO3 = 9(g) Câu 56 Chọn B BT: C ⎯⎯⎯ → n CO2 = n Na 2CO3 + n NaHCO3 = 0,035 mol  VCO2 = 0,784 (l) Câu 60 Chọn A BTKL ⎯⎯⎯ → n HCl = n a = CH5 N % m X = 73,37% 3,515 − 1, 69 = 0, 05 mol  M a = 33,8 →   36,5 C2 H N %m Y = 26, 63% Câu 61 Chọn B C H ONa : 0, 001 mol Chất tan gồm   m = 0, 476 (g)  NaOH : 0, 009 mol Câu 63 Chọn A Vật liệu tổng hợp phản ứng trùng ngưng tơ nilon-6,6, tơ lapsan Câu 65 Chọn A Este có dạng RCOOR’, tác dụng với NaOH tạo thành muối có dạng RCOONa Nhận thấy: mmuối > meste  MR’ < 23  Hai ancol CH3OH C2H5OH BTKL Gọi x số mol chất X, Y Khi đó: ⎯⎯⎯ → 27,9 + 40.(x + x) = 28, + 32x + 46x  x = 0,15 28, Mà Mmuối = = 94 : CH = CHCOONa → X CH2=CHCOOCH3 có %m = 46,24% 0,3 Câu 66 Chọn A + Giai đoạn 1: Cho hỗn hợp CaCO3, CaSO3 tác dụng với HCl thu hỗn hợp khí X CO2, SO2 + Giai đoạn 2: Dẫn X vào nước brom SO2 bị hấp thụ, khí CO2 + Giai đoạn 3: Khi Y thu CO2 (vì CO2 tan nước) A Đúng, Vì SO2 + Br2 + 2H2O → H2SO4 + 2HBr lúc nhỏ dung dịch BaCl2 vào bình đựng nước brom sau thí nghiệm kết thúc thấy có kết tủa trắng xuất BaSO4 B Sai, Khí CO2 khơng làm nhạt màu dung dịch KMnO4 nhiệt độ thường C Sai, Khơng có khí H2S tạo thành D Sai, Khí CO2 khơng phản ứng với dung dịch CaCl2 Câu 67 Chọn B Nhận thấy: n H2O  n CO2  X amino axit no có nhóm amino nhóm cacboxyl Khi X có dạng CnH2n+1O2N  n X = 2(n H2O − n CO2 ) = 0, 01 mol  n = Trong 29,25 gam X có 0,25 mol X  n H2SO4 = n OH− − n X BTKL ⎯⎯⎯ → a = mX + mH2SO4 + mNaOH + mKOH − mH2O = 0,1mol = 52,95(g) Câu 68 Chọn C Mg bị ăn mòn điện hố nhúng vào dung dịch AgNO3 CuCl2 Câu 69 Chọn D (a) Đúng (b) Đúng (c) Đúng (d) Sai, Vì giá trị nhỏ n m (e) Đúng (g) Đúng Câu 70 Chọn A Dựa vào kiện đề cho ta suy cơng thức X C2H4(OH)2, CH3COOH, (COOH)2 Câu 72 Chọn C m − mX Ta có: n O = Y = 0,175 mol  n HCl = n Cl− = 2n H + 2n O = 0,95 mol 16  mZ = mX + mCl− = 47,875 (g) Câu 73 Chọn D Theo đề ta có: a < 2b nên KCl điện phân hết CuSO4 dư Catot: Cu2+ + 2e → Cu Anot: 2Cl– → Cl2 + 2e 2H2O → 4H+ + O2 + 4e + Q trình 1: Khơng đổi + Quá trình 2: [H+] tăng  PH giảm Câu 74 Chọn B (a) Đúng (b) Sai, Saccarozơ bị hoá đen tiếp xúc với H2SO4 đặc (c) Sai, Dung dịch anilin khơng làm quỳ tím đổi màu (d) Đúng (e) Đúng (g) Đúng Câu 75 Chọn A (a) Khí H2 không tác dụng với Al2O3 (b) 2CuSO4 + 2H2O → 2Cu + 2H2SO4 + O2 (c) 2Na + CuSO4 + 2H2O → Cu(OH)2 + Na2SO4 + H2 (d) Fe + H2SO4 → FeSO4 + H2 (e) Zn + 2AgNO3 → Zn(NO3)2 + 2Ag o t → 2Ag + 2NO2 + O2 (g) 2AgNO3 ⎯⎯ Câu 76 Chọn C Các công thức cấu tạo A thoả mãn H-COO-CH2-CH(OH)-CH2-OOC-CH=CH2 ; H-COO-CH(CH2OH)-CH2-OOC-CH=CH2 ; CH2=CH-COO-CH(CH2OH)-CH2-OOC-H (a) Đúng (b) Sai, Dung dịch A khơng làm quỳ tím đổi màu (c) Sai, Khi cho phản ứng H2 (xúc tác Ni, t°) phân tử A phản ứng tối đa phân tử H2 (d) Đúng (e) Sai, Có đồng phân cấu tạo thỏa mãn A (g) Đúng Câu 77 Chọn C CH NH3HCO3 : x mol  x + y = 0, 25  x = 0,1 X gồm  →   m X = 25,355 (g) HOCH 2COONH3CH3 : y mol 106x + 98y = 25,3  y = 0,15 Câu 78 Chọn C CO : 0,15 mol Hỗn hợp X gồm  → n MgCO3 = 0,15 mol  NO : 0, 04 mol Dung dịch Y có Mg2+ (x mol), Cl- (1,21 mol), NH4+ (y mol) BTDT n NO + n NH +  ⎯⎯⎯ → 2x + y = 1, 21  x = 0,  BT:N Lập hệ:   ⎯⎯⎯ → n Mg(NO3 )2 = = 0, 025 mol y = 0, 01 24x + 18y = 14,58    BT: e ⎯⎯⎯ → n Mg = 3n NO + 8n NH + Câu 79 Chọn A = 0,1 mol  n MgO = 0,325 mol  %mMgO = 41% X, Y, Z CH3COOCH3, (CH3COO)2C2H4, (CH3COO)3C3H5 3n + 5n Y + 7n Z = 0, 245 (1) (2) − 2.(1) Theo đề ta có:  X ⎯⎯⎯⎯ → n X + 2n Y + 3n Z = 0,1 32n + 62n + 92n = 3, 09 (2) X Y Z  BTKL ⎯⎯⎯ → mA = 0,1.82 + 3, 09 − 0,1.40 = 7, 29 (g) Câu 80 Chọn A Quy đổi hỗn hợp thành BT: Na  ⎯⎯⎯→ x = 2n Na 2CO3 = 0, 26 mol C2 H3ON : x mol  C H O NNa   y = 0,12   →  57x + 14y + 18z = 17,  CH : y mol CH H O : z mol 44.(2x + y − 0,13) + 18.(2x + y) + 28.0,5 x = 37, z = 0, 05    n X + n Y = 0, 05 n X = 0, 04 AlaNa : a mol a + b = 0, 26 Muối gồm  →  a = 0,14   GlyNa : b mol b = 0,12 5n X + 6n Y = 0, 26 n Y = 0, 01 X : (Gly)2 (Ala)3 n = BT:Gly ⎯⎯⎯→ n.0, 04 + m.0, 01 = 0,12   →  %m Y = 23,91% m = Y : (Gly)4 (Ala) HẾT ...III ĐÁP ÁN THAM KHẢO: PHẦN ĐÁP ÁN 41A 51D 61B 71D 42D 52C 62B 72C 43B 53C 63A 73D 44B 54B 64B 74B 45D 55C 65A 75A 46C 56B... 3n + 5n Y + 7n Z = 0, 245 (1) (2) − 2. (1) Theo đề ta có:  X ⎯⎯⎯⎯ → n X + 2n Y + 3n Z = 0 ,1 32n + 62n + 92n = 3, 09 (2) X Y Z  BTKL ⎯⎯⎯ → mA = 0 ,1. 82 + 3, 09 − 0 ,1. 40 = 7, 29 (g) Câu 80 Chọn... 78 Chọn C CO : 0 ,15 mol Hỗn hợp X gồm  → n MgCO3 = 0 ,15 mol  NO : 0, 04 mol Dung dịch Y có Mg2+ (x mol), Cl- (1, 21 mol), NH4+ (y mol) BTDT n NO + n NH +  ⎯⎯⎯ → 2x + y = 1, 21  x = 0,  BT:N
- Xem thêm -

Xem thêm: Đáp án và lời giải đề thi thử THPT QG 2019 môn hóa học THPT chuyên lê hồng phong nam định lần 1 file word có ma trận lời giải chi tiết www hoctai vn , Đáp án và lời giải đề thi thử THPT QG 2019 môn hóa học THPT chuyên lê hồng phong nam định lần 1 file word có ma trận lời giải chi tiết www hoctai vn

Gợi ý tài liệu liên quan cho bạn