KIỂM TRA CHƯƠNG ESTE LIPIT LỚP 12 CHƯƠNG TRÌNH CHUẨN HÓA HỌC TRUNG HỌC PHỔ THÔNG

13 27 0
  • Loading ...
1/13 trang

Thông tin tài liệu

Ngày đăng: 15/03/2019, 08:23

Câu 1: Một este đơn chức mạch hở có tỉ khối so với H2 bằng 50. Khi thủy phân trong môi trường kiềm không tạo ra sản phẩm có khả năng tham gia phản ứng tráng gương: Số đồng phân cấu tạo este thỏa mãn là:A. 2B. 4C. 5D. 6Câu 2: Số đồng phân của este có công thức phân tử C6H12O2 khi thủy phân tạo ra ancol không bị oxi hóa bởi CuO.A. 1B. 2C. 3D. 4Câu 3: Khi đốt cháy hoàn toàn một este no, đơn chức thì số mol CO2 sinh ra bằng số mol O2 đã phản ứng. Tên gọi của este làA. metyl fomiat.B. etyl axetat. C. npropyl axetat. D. metyl axetat.Câu 4: Đốt cháy hoàn toàn m gam hỗn hợp 2 este no, đơn chức, mạch hở cần dùng 30,24 lít O2 (đktc), sau phản ứng thu được 48,4 gam khí CO2. Giá trị của m là:A. 68,2 gamB. 25 gamC. 19,8 gamD. 43 gamCâu 5: Este có các tính chất sau: Thủy phân trong dung dịch NaOH đều cho hai sản phẩm (X, Y) và chỉ có một sản phẩm Y cho phản ứng tráng gương. Cho Y tráng gương tạo được Y1, đun nóng Y1 với NaOH tạo được X. CTCT của este là:A. CH3COOCH=CHCH3B. C2H5COOCH=CH2.C. HCOOCH=CH3.D. CH3CH(CH3)COOCH=C(CH3)2.Câu 6: Hỗn hợp gồm phenyl axetat và metyl axetat có khối lượng 7,04 gam thủy phân trong NaOH dư, sau phán ứng thu được 9,22 gam hỗn hợp muối. % theo khối lượng của hai este trong hỗn hợp ban đầu là:A. 64,53% và 35,47% B. 53,65% và 46,35%C. 54,44% và 45,56% D. 57,95% và 42,05%Câu 7: Đốt cháy hoàn toàn một este đơn chức thu được 8,8 gam CO2. Nếu xà phòng hóa hoàn toàn lượng este này thì cần vừa đúng: 20 gam NaOH 10%. Hiđrô hóa hoàn toàn lượng este này thì cần 2,24 lít khí H2 ( đktc). CTCT của este trên là:A. CH2 = CHCOOCH3. B. CH ≡ CCOOCH3C. CH2=CHCOOCH=CH2.D. HCOOCH=CH2.Câu 8: Đốt cháy hoàn toàn m gam etyl axetat bằng lượng oxi vừa đủ, toàn bộ sản phẩm đem dẫn qua dung dịch Ca(OH)2 sau phản ứng thu đuợc 19,68 gam kết tủa và khối lượng của dung dịch tăng thêm 20 gam. Giá trị của m ban đầu là:A. 7,04 gam.B. 14,08 gam.C. 56,32 gam.D. 28,16 gam.Câu 9: Cho các este có tên gọi sau đây: metyl acrylat; vinyl axetat; alyl fomiat; isopropenyl fomiat, metyl metacrylat. Trong các este trên, có bao nhiêu este có cùng chung một công thức phân tử.A. 2B. 3C. 4D. 5Câu 10: Hỗn hợp hai este đơn chức A và B là đồng phân của nhau có khối lượng 2.59 gam tác dụng vừa đủ với 40 ml dung dịch NaOH ,0,875M sau phản ứng thu được 2,66 gam muối. % theo số mol của hai ancol thu được sau phản ứng là:A. 48,12% và 51,88%B. 57,14% và 42,86%C. 50% và 50%D. 45,14% và 54,86%.Câu 11: Đốt cháy hoàn toàn hỗn hợp gồm: Axit propionic; metyl fomiat; metyl propionat; etyl axetat thì cần dùng vừa đủ 9,52 lít khí O2 ( đktc). Sau phản ứng thu được 15,4 gam CO2. Nếu cho hỗn hợp ban đầu đem phản ứng với NaOH 0,5M thì thể tích của NaOH ít nhất cần dùng để phản ứng hết với hỗn hợp là:A. 200 ml.B. 100 mlC. 400 mlD. 300 ml. BÀI TẬP TỔNG HỢP CHƯƠNG ESTE- LIPIT Câu 1: Một este đơn chức mạch hở có tỉ khối so với H2 50 Khi thủy phân môi trường kiềm khơng tạo sản phẩm có khả tham gia phản ứng tráng gương: Số đồng phân cấu tạo este thỏa mãn là: A B C D Câu 2: Số đồng phân este có cơng thức phân tử C6H12O2 thủy phân tạo ancol khơng bị oxi hóa CuO A B C D Câu 3: Khi đốt cháy hoàn tồn este no, đơn chức số mol CO2 sinh số mol O2 phản ứng Tên gọi este A metyl fomiat B etyl axetat C n-propyl axetat D metyl axetat Câu 4: Đốt cháy hoàn toàn m gam hỗn hợp este no, đơn chức, mạch hở cần dùng 30,24 lít O2 (đktc), sau phản ứng thu 48,4 gam khí CO2 Giá trị m là: A 68,2 gam B 25 gam C 19,8 gam D 43 gam Câu 5: Este có tính chất sau: Thủy phân dung dịch NaOH cho hai sản phẩm (X, Y) có sản phẩm Y cho phản ứng tráng gương Cho Y tráng gương tạo Y1, đun nóng Y1 với NaOH tạo X CTCT este là: A CH3COOCH=CH-CH3 B C2H5COOCH=CH2 C HCOOCH=CH3 D CH3CH(CH3)COOCH=C(CH3)2 Câu 6: Hỗn hợp gồm phenyl axetat metyl axetat có khối lượng 7,04 gam thủy phân NaOH dư, sau phán ứng thu 9,22 gam hỗn hợp muối % theo khối lượng hai este hỗn hợp ban đầu là: A 64,53% 35,47% B 53,65% 46,35% C 54,44% 45,56% D 57,95% 42,05% Câu 7: Đốt cháy hoàn toàn este đơn chức thu 8,8 gam CO2 Nếu xà phòng hóa hồn tồn lượng este cần vừa đúng: 20 gam NaOH 10% Hiđrơ hóa hồn tồn lượng este cần 2,24 lít khí H2 ( đktc) CTCT este là: A CH2 = CH-COOCH3 B CH ≡ C-COOCH3 C CH2=CH-COOCH=CH2 D HCOOCH=CH2 Câu 8: Đốt cháy hoàn toàn m gam etyl axetat lượng oxi vừa đủ, toàn sản phẩm đem dẫn qua dung dịch Ca(OH)2 sau phản ứng thu đuợc 19,68 gam kết tủa khối lượng dung dịch tăng thêm 20 gam Giá trị m ban đầu là: A 7,04 gam B 14,08 gam C 56,32 gam D 28,16 gam Câu 9: Cho este có tên gọi sau đây: metyl acrylat; vinyl axetat; alyl fomiat; isopropenyl fomiat, metyl metacrylat Trong este trên, có este có chung công thức phân tử A B C D Câu 10: Hỗn hợp hai este đơn chức A B đồng phân có khối lượng 2.59 gam tác dụng vừa đủ với 40 ml dung dịch NaOH ,0,875M sau phản ứng thu 2,66 gam muối % theo số mol hai ancol thu sau phản ứng là: A 48,12% 51,88% B 57,14% 42,86% C 50% 50% D 45,14% 54,86% Câu 11: Đốt cháy hoàn toàn hỗn hợp gồm: Axit propionic; metyl fomiat; metyl propionat; etyl axetat cần dùng vừa đủ 9,52 lít khí O2 ( đktc) Sau phản ứng thu 15,4 gam CO2 Nếu cho hỗn hợp ban đầu đem phản ứng với NaOH 0,5M thể tích NaOH cần dùng để phản ứng hết với hỗn hợp là: A 200 ml B 100 ml C 400 ml D 300 ml Câu 13: Một este đơn chức có % O = 37,21% Số đồng phân este mà sau thủy phân cho sản phẩm tham gia phản ứng tráng gương : A B C D Câu 14: Xà phòng hóa hồn tồn 17,4 gam este đơn chức X cần dùng vừa đủ 300 ml dung dịch NaOH 0,5M thu muối A ancol B Oxi hóa B thu xeton Công thức cấu tạo X là: A HCOOCH(CH3)2 B CH3COOCH2CH(CH3)2 C CH3CH2COOCH(CH3)2 D HCOOCH(CH3)CH2CH3 Câu 15: Hỗn hợp gồm hai este A B đồng đắng cacbon phân tử Khi đốt cháy hoàn toàn hỗn hợp thu 16,28 gam CO2 5,22 gam nước CTCT hai este : A CH3COOCH=CH2 ; CH2=CH-COOC2H5 B CH3COOCH3 CH3COOC2H5 C CH3COOC2H5 C2H5COOC2H5 D CH2=CH-COOCH3và CH2=C(CH3)COOCH3 Câu 16: Đốt cháy hoàn toàn 0,014 mol hỗn hợp hai este A B đồng đẳng cua nhau, nhóm CH2, sản phẩm cháy cho qua bình đựng 500 ml dung dịch Ca(OH)2 0.08M thu gam kết tủa khối lượng dung dịch tăng thêm 0,1 gam Nếu tiếp tục đun nóng dung dịch sau phản ứng thu tiếp kết tủa Công thức hai este là: A CH3COOCH3; HCOOCH3 B CH3COOCH3 CH3COOCH2CH3 C HCOOC2H5 CH3COOCH3 D HCOOCH=CH2và CH3COOCH=CH2 Câu 17: Đốt cháy m gam este no đơn chức thu a gam H2O Nếu lấy m/2 gam este đem thủy phân hoàn toàn thu hỗn hợp X gồm ancol axit Đốt cháy hỗn hợp X thu b gam CO2 Biểu thức sau a 44 18 11a C b = A b = a 44 a D b = 22, B b = Ni Câu 18: Axit X + 2H2 �� � axit Y Tên gọi axit X Y là: A Axit panmitic; axit oleic B Axit lioleic axit oleic C Axit oleic axit steric D Axit lioleic axit stearic Câu 19: Cho este sau đây: C6H5OOC-CH2-COOCH3 Để phản ứng hết với 19,4 gam este dung dịch chứa gam KOH A 16,8 B 11,2 C 12 D Câu 20: Đốt cháy hoàn toàn este đơn chức, mạch hở có liên kết pi phân tử San phản ứng thu a gam CO2 b gam H2O Nếu cho este tác dụng với NaOH cần dùng vừa đủ dung dịch chứa x gam NaOH Biểu thức sau a - b) 11 a b C x =  44 18 A x = 40.( B x = 10 20 ab 11 D x = 40.(a - b) Câu 21: Chọn câu sai: A Đun nóng chất béo với NaOH dư, sản phẩm tạo có khả hòa tan Cu(OH)2 B Để chuyển dầu thực vật thành bơ người ta tiến hành hiđrô hóa dầu thực vật với xúc tác Ni C Khi cho Glixerol đun nóng với hỗn hợp hai axit béo: stearic axit oleic sản phẩm thu chất béo trạng thái rắn D Khi đun nóng chất béo với dung dịch NaOH KOH nguời ta thu xà phòng Câu 22: Để trung hòa luợng axit tự có 5,6 gam chất béo cần 0,02 gam NaOH Chỉ số axit béo xà phòng là: A 3,57 B C 4,45 D Câu 23: Hỗn hợp gồm este, đơn chức, no có cơng thức phân tử C4H8O2 C5H10O2 thủy phân mơi trường kiềm thu tối đa ancol khác muối Vậy muối là: A CH3COONa B HCOONa C C3H7COONa D C2H5COONa Câu 24: Một loại chất béo gồm panmitin stearin Đun nóng 42,82 kg chất béo với NaOH, khối lượng glixerol thu 4,6 kg % theo khối lượng hai trieste chất béo là: A 40% 60% B 36,55% 63.45% C 42,15% 57,85% D 37,65% 62,35% Câu 25: xà phòng hóa hồn tồn loại chất béo cần vừa đủ 2,44 kg NaOH, sau phản ứng thu 1,84 kg Glixerol 17,202 kg xà phòng Khối lượng chất béo ban đầu đem thủy phân là: ( Biết phản ứng xà phòng hóa xảy hồn tồn) A 16,202kg B 16,620kg C 16,602kg D 16,642kg Câu 26: Cho glixerol tác dụng với hỗn hợp axit cacboxilic đơn chức, hỏi sản phẩm thu tối đa trieste có cơng thức cấu tạo khác A 14 B 18 C 12 D 15 Câu 28: Cho triolein vinyl axetat vào ống nghiệm chứa riêng biệt: Na, Cu(OH) 2, dung dịch brôm, dung dịch NaOH Trong điều kiện thích hợp, số phản ứng hóa học xảy ra: A B C D Câu 29: Chỉ điểm không axit béo thường gặp: A Đều axit cacboxilic đơn chức B Có mạch dài khơng phân nhánh C Đều axit cacboxylic no D Có số chẵn nguyên tử Cacbon phân tử Câu 30: Khi thủy phân hoàn toàn gam este CH3COOCH2CH2OOCCH3 NaOH, sản phẩm thu hòa tan tốt đa m gam Cu(OH)2 m có giá trị A 1,34 B 24,5 C 49 D 12,25 Câu 31: Khi cho đồng phân bền có cơng thức phân tử C2H4O2 tác dụng với Na( tạo H2), NaOH ( tạo muối), Na2CO3 ( tạo CO2) AgNO3/NH3 (tạo Ag) Các điều kiện phản ứng hóa học có đủ: Số phản ứng hóa học xảy là: A B C D Câu 32: Hai este A B có CTPT CH3COOR CH3COOR/ có khối lượng 5,56 gam tác dụng vừa đủ với NaOH thu 4,92 gam muối hai ancol , hai ancol thu đem oxi hóa CuO thu hai anđêhit, lượng anđêhit tác dụng với lượng dư dung dịch AgNO3/NH3 thu tối đa 17,28 gam kết tủa Nếu đốt cháy hoàn toàn hỗn hợp hai este tổng khối lượng CO2 H2O thu là: A 16,12 gam B 13,64 gam C 17,36 gam D 32,24 gam Câu 33: Thủy phân hoàn toàn 0,1 mol este X cần vừa 32 gam dung dịch NaOH 25% thu hai ancol A B có tỉ khối H2 22,5 Nếu đốt cháy hoàn toàn 0,1 mol este X thu 30,8 gam CO2 Công thức cấu tạo este X là: A CH3OOCCH2-CH2COOC2H5 B CH3OOC-CH2-COOCH2-CH=CH2 C CH3OOC-CH(CH3)-COOC2H5 D CH3OOC-CH2-CH2-CH2COOCH2-CH=CH2 Câu 34: Xà phòng hóa 36,4 kg chất béo có số axit cần dùng vừa 7,366 kg KOH Nếu hiệu suất phản ứng đạt 100% khối lượng xà phòng thu là: A 39,765kg B 39,719kg C 31,877kg D 43,689 kg Câu 35: A, B, C ba hợp chất hữu đơn chức đồng đẳng MA < MB < MC không tác dụng với Na Tỉ khối hỗn hợp gồm mol A mol C H2 47,5 Nếu đốt cháy hoàn toàn 0,2 mol B dẫn tồn sản phẩm cháy qua bình đựng nước vơi lấy dư khối lượng bình tăng lên: A 35,2 gam B 24,8 gam C 37,2 gam D 49,6 gam Câu 38: Thủy phân hoàn toàn 0,2 mol este cần vừa 80 gam dung dịch NaOH 30% sau phản ứng thu 54,8 gam muối hai axit cacboxilic đơn chức Hai axit là: A C2H5COOH C3H7COOH B HCOOH C2H5COOH C CH3COOH C2H5COOH D CH3COOH C2H3COOH Câu 39: Este sau bị thủy phân cho muối ancol A HO-CH2CH2COOCH2CH2COOCH3 B CH3COOC6H5 C CH3COOCH2COOCH3 D CH3COOCH2OOCC2H5 Câu 40: Đun sôi 13,4 gam hỗn hợp gồm hai chất hữu đơn chức, nhóm CH2 với 200ml dung dịch NaOH 1M phản ứng vừa đủ thu ancol 16,4 gam muối Toàn lượng ancol phản ứng với Na dư thu 1,12 lít khí H2 ( đktc) % theo khối lượng chất hỗn hợp là: A 55,22% 44,78% B 45,25% 54,75% C 53,22% 46,78% D 50% 50% Câu 41: Nhận định sau không đúng? A Tên este RCOOR’ gồm: tên gốc hiđrocacbon R’ + tên anion gốc axit (đuôi “at”) B Khi thay nguyên tử H nhóm –COOH axit cacboxylic gốc hiđrocacbon este C Phản ứng thuỷ phân este môi trường kiềm phản ứng chiều gọi phản ứng xà phòng hố D Các este chất lỏng chất rắn điều kiện thường chúng tan nước Câu 42: Một este tạo từ axit no đơn chức ancol no, bậc III đơn chức mạch hở Vậy công thức chung este : A CnH2nO2 ( n≥5) B CnH2nO2 ( n≥4) C CnH2nO2 ( n≥3) D CnH2nO2 (n≥2) Câu 43: Đốt cháy hoàn toàn lượng hỗn hợp hai este cho sản phẩm cháy qua bình đựng P2O5 dư thấy khối lượng bình tăng thêm 6,21g, sau cho qua dd Ca(OH)2 dư thu 34,5g kết tủa Các este nói thuộc loại: A No, đơn chức, mạch hở B No, đa chức, mạch hở C Không no, đơn chức, mạch hở D Không no, đa chức, mạch hở Câu 44: Một este có cơng thức phân tử C4H8O2, thủy phân môi trường axit thu rượu Y Oxi hóa rượu Y thành anđehit Y1 sau cho Y1 tham gia phản ứng tráng gương thu số mol Ag gấp lần số mol Y1 Vậy tên gọi este : A Metyl propionat B Etyl axetat C n-propyl fomiat D Isoproyl fomiat  O2 , xt  H 2O , H  Câu 45: Este X ( C4H8O2) thoả mãn điều kiện: X ���� Y1 ��� � Y2 � Y1 + Y2 ; X có tên là: A Isopropyl fomiat B Propyl fomiat C Metyl propionat D Etyl axetat Câu 46: Cho sơ đồ sau: O2 , xt  NaOH  NaOH NaOH X (C4 H 8O2 ) ���� Y ��� � Z ���� T ��� � C2 H Công thức cấu tạo thu gọn X CaO ,t o A CH3COOC2H5 B C2H5COOCH(CH3)2 C CH3CH2CH2COOH D HCOOCH2CH2CH3 Câu 47: Cho este X có cơng thức phân tử C4H6O4 điều chế từ axit đơn chức A ancol B Đun nóng 0,1 mol X 200ml dung dịch NaOH 1,5M sau đem cạn cẩn thận thu gam chất rắn khan? A 13,6 gam B 15,6 gam C 17,6 gam D 20,4 gam Câu 48: Cho 0,3 mol axit X đơn chức trộn với 0,25 mol ancol etylic đem thực phản ứng este hóa thu thu 18 gam este Tách lấy lượng ancol axit dư cho tác dụng với Na thấy 2,128 lít H2 Vậy công thức axit hiệu suất phản ứng este hóa A CH3COOH, H% = 68% B CH2=CH-COOH, H%= 78% C CH2=CH-COOH, H% = 72% D CH3COOH, H% = 72% Câu 49: Khối lượng axit metacrylic ancol metylic cần lấy để điều chế 100 kg poli(metylmetacrylat) ? (Cho biết hiệu suất toàn trình điều chế đạt 80%) A 86 kg 32 kg B 107,5 kg 40 kg C 68,8 kg 25,6 kg D 75 kg 30 kg Câu 50: Hỗn hợp A gồm axit axetic etanol Chia A thành ba phần + Phần tác dụng với Kali dư thấy có 3,36 lít khí + Phần tác dụng với Na2CO3 dư thấy có 1,12 lít khí CO2 Các thể tích khí đo đktc + Phần thêm vào vài giọt dung dịch H2SO4, sau đun sôi hỗn hợp thời gian Biết hiệu suất phản ứng este hoá 60% Khối lượng este tạo thành bao nhiêu? A 8,80 gam B 5,20 gam C 10,56 gam D 5,28 gam Câu 51: Để đốt cháy hoàn toàn mol axit cacboxylic đơn chức X cần đủ 3,5 mol O2 Trộn 7,4 gam X với lượng đủ ancol no Y (biết tỉ khối Y so với O2 nhỏ 2) Đun nóng hỗn hợp với H2SO4 làm xúc tác Sau phản ứng hoàn toàn thu 8,7 gam este Z (trong Z khơng nhóm chức khác) Cơng thức cấu tạo Z là: A C2H5COOCH2CH2OCOC2H5 B C2H3COOCH2CH2OCOC2H3 C CH3COOCH2CH2OCOCH3 D HCOOCH2CH2OCOH Câu 52: Giả sử điều kiện thích hợp, người ta thực phản ứng este hóa vừa đủ 12,4 gam etylenglicol với m gam hỗn hợp hai axit hữu đơn chức no mạch hở đồng đẳng kế tiếp, thu 32 gam hỗn hợp ba este đa chức Công thức hai axit hữu đem dùng là: A HCOOH, CH3COOH B CH3COOH, CH3CH2COOH C CH3CH2COOH, CH3CH2CH2COOH D C3H7COOH, C4H9COOH Câu 53: Hỗn hợp E gồm este có số mol nhau, đa chức axit oxalic hai rượu đơn chức, no, mạch hở, đồng đẳng Thực phản ứng xà phòng hóa hồn tồn 4,8 gam hỗn hợp E dung dịch xút vừa đủ thấy dùng hết 19,48 ml dung dịch NaOH 11% (có khối lượng riêng 1,12 g/ml) Công thức hai rượu tạo nên hỗn hợp E là: A CH3OH, C2H5OH B C4H9OH, C5H11OH C C2H5OH, C3H7OH D C5H11OH, C6H13OH Câu 54: Đốt cháy hoàn toàn 7,6 gam hỗn hợp gồm axit cacboxylic no, đơn chức, mạch hở ancol đơn chức (có số nguyên tử cacbon phân tử khác nhau) thu 0,3 mol CO2 0,4 mol H2O Thực phản ứng este hóa 7,6 gam hỗn hợp với hiệu suất 80% thu m gam este Giá trị m A 4,08 B 6,12 C 8,16 D 2,04 Bài 55 Hỗn hợp X gồm ancol no, đơn chức axit no, đơn chức mạch hở Chia X thành phần nhau: - Đốt cháy hoàn tồn phần sản phẩm thu cho qua bình nước vơi dư thấy có 30 gam kết tủa - Phần este hố hồn tồn vừa đủ thu este, đốt cháy este thu khối lượng H2O A 1,8 gam B 3,6 gam C 5,4 gam D 7,2 gam Bài 56 Hỗn hợp X gồm HCOOH, CH3COOH C2H5COOH (tỉ lệ 5:1:1) Lấy 5,2 gam hỗn hợp X tác dụng với 5,75 gam C2H5OH (có H2SO4 đặc làm xúc tác) thu m gam hỗn hợp este (hiệu suât phản ứng este hóa 80%) Giá trị m A 6,4 B 8,0 C 6,48 D 8,1 Câu 57: Một loại mỡ chứa 40% triolein, 20% tripanmitin, 40% tristearin (về số mol) Xà phòng hố hồn tồn m gam mỡ NaOH thu 138 gam glixerol Giá trị m là? A 1209 B 1304,27 C 1306,2 D 1335 Câu 58: Một loại chất béo chứa 4,23% axit oleic, 1,6% axit panmitic lại triolein Chỉ số xà phòng hóa mẫu chất béo là: A 109,6 B 163,2 C 190,85 D 171,65 Câu 59: Xà phòng hóa hồn tồn 10 gam chất béo trung tính cần 1,68 gam KOH Từ chất béo điều chế xà phòng natri loại 72% A 1,028 B 1,428 C 1,513 D 1,628 Câu 60 Cho phát biểu sau: (1) Nguyên nhân làm dầu mỡ bị ôi thiu liên kết pi gốc hiđrocacbon axit béo không no (2) Các triglixerit chứa chủ yếu gốc axit béo no thường chất lỏng nhiệt độ thường (3) Thủy phân este môi trường axit phản ứng thuận nghịch (4) Các este có nhiệt độ sơi cao axit có số nguyên tử cacbon (5) Các chất béo không tan nước tan nhiều dung môi hữu (6) Cho metyl axetat tristearin vào dung dịch NaOH đun nóng xảy phản ứng xà phòng hóa Số phát biểu là: A B C D Câu 61 Cho chất sau: axit propionic (X), axit axetic (Y), ancol etylic (Z) etyl propionat (T) Dãy gồm chất xếp theo chiều tăng nhiệt độ sôi ? A Y, T, X, Z B T, X, Y, Z C T, Z, Y, X D Z, T, Y, X Câu 62 Cho glixerol tác dụng với hỗn hợp ba axit C17H35COOH, C17H33COOH C15H31COOH Số loại trieste tạo thành chứa hai gốc axit số ba axit béo A B C 12 D 10 Câu 63 Cho dãy chất: phenyl axetat, metyl benzoat, metyl metacrylat, anlyl axetat, metyl axetat, etyl fomat, triolein, vinyl axetat, tristearin Số chất dãy thủy phân dung dịch NaOH loãng (dư), đun nóng sinh ancol A B C D H O O 2 � Y1 + Y2 ; Y1 �� � � Y2 Tên gọi X là: Bài 64 Este X có CTPT C4H8O2 Biết: X ��� xt H A isopropyl fomat B etyl axetat C metyl propionat Bài 65 Chất hữu X mạch hở có CTPT C4H6O2, biết rằng: D n-propyl fomat  NaOH  ddNaOH etilen CTCT X : X ���� � muối Y ���� Cao , t o A CH2=CH-CH2-COOH B CH2=CHCOOCH3 C HCOOCH2–CH=CH2 D CH3 COOCH=CH2 LỜI GIẢI CHI TIẾT Câu 1: Đáp án : D M este = 50.2 = 100 => Este C5H8O2 Các đồng phân thỏa mãn là: CH3COOCH2CH=CH2 ; CH3COOC(CH3)=CH2 ; CH2=CH-COOCH2CH3 ; CH2=CH-CH2COOCH3 ; CH3-CH=CHCOOCH3 ; CH2=C(CH3)-COOCH3 => Đáp án D Câu 2: Đáp án : B Ancol khơng bị oxi hóa CuO => Ancol bậc Các đồng phân thỏa mãn : CH3COOC(CH3)3 ; HCOOC(CH3)2 - C2H5 Câu 3: Đáp án : A Gọi este CnH2nO2 , ta có: CnH2nO2 + => 3n  to O2 �� � nCO2 + H2O 3n  = n n = => Este HCOOCH3 (Metyl format) Câu 4: Đáp án : B Ta có : Este + O2  CO2 + H2O Vì este no, đơn chức , mạch hở => nCO2 = nH2O = 48, = 1,1 mol 44 Bảo toàn khối lượng => meste + mO2 = mCO2 + mH2O => m = 1,1.(44 + 18) - 1,35.32 = 25 g Câu 5: Đáp án : D Ta thấy: CH3CH(CH3)COOCH=C(CH3)2 + NaOH  CH3CH(CH3)COONa + CH3CH(CH3)CHO (X) (Y)  AgNO3 / NH  NaOH CH3CH(CH3)CHO ����� � CH3CH(CH3)COONH4 (Y1) ���� CH3CH(CH3)COONa (X) Câu 6: Đáp án : D CH 3COOC6 H � + NaOH  CH3COONa + C6H5ONa + CH3OH � CH 3COOCH � Đặt nCH3COOC6H5 = x ; nCH3COOCH3 = y Ta Có: 136 x  74 y  7, 04 � �x  0, 03 �� � 82 x  116 x  82 y  9, 22 � �y  0, 04 0, 03.136 => % CH3COOC6H5 = = 57,95 % 7, 04 => % CH3COOCH3 = 42,05 % Câu 7: Đáp án : B Vì este đơn chức => neste = nNaOH = 0,05mol nCO2 = 0,2 mol => Số C este là: 0, =4 0, 05 nH2 = 0,1 mol = 2neste => Este có liên kết π gốc hidrocacbon => Este CH ≡ C-COOCH3 Câu 8: Đáp án : B m dung dịch tăng = 20 g => mCO2 + mH2O - m kết tủa = 20 => mCO2 + mH2O = 20 + 19,68 = 39,68 g mà nCO2 = nH2O => nCO2 = => nCH3COOC2H5 = 39, 68 = 0,64 mol 44  18 0, 64 = 0,16 mol => m = 0,16.88 = 14,08 g Câu 9: Đáp án : C Ta thấy: +) Metyl acrylat : CH2=CH-COOCH3 +) Vinyl axetat : CH3COOCH=CH2 +) Alyl fomiat : HCOOCH2-CH=CH2 +) Isopropenyl fomiat : HCOOC(CH3)=CH2 +) Metyl metacrylat : CH2=C(CH3)COOCH3 => Có chất có cơng thức phân tử Câu 10: Đáp án : B nNaOH = 0,035 mol => neste = 0,035 mol => M = 2,59 = 74 0, 035 =>Este CH3COOCH3 HCOOC2H5 Đặt nCH3COOCH3 = x , nHCOOC2H5 = y Ta được: �x  y  0, 035 � 82 x  68 y  2, 66 � => x = 0,02 mol , y = 0,015 mol => % CH3OH = x = 57,14% x y % C2H5OH = 42,68 % Câu 11: Đáp án : A nO2 = 0,425 mol ; nCO2 = 0,35 mol Vì este no, hở, đơn chức => nH2O = nCO2 = 0,35 mol Bảo toàn nguyên tố oxi => nO (trong este) = 2nCO2 + nH2O – 2nO2 = 0,2 mol => neste = 0,1 0, = 0,1 mol => VNaOH = = 0,2 lít = 200 ml 0, Câu 13: Đáp án : C Este đơn chức => Chứa nguyên tử oxi => Meste = 32 = 86 0,3721 => Este C4H6O2 => Các đồng phân thỏa mãn : HCOOCH2-CH=CH2 ; HCOOC(CH3)=CH2 ; CH3COOCH=CH2 Câu 14: Đáp án : C nNaOH = 0,15 mol => neste = 0,15 mol => Meste = 17, = 116 => Este C6H12O2 0,15 Oxi hóa B tạo xeton => B ancol bậc Xét phương án cho => X CH3CH2COOCH(CH3)2 Câu 15: Đáp án : D Giả sử este có độ bất bão hòa k 0,37  0, 29 0, 08  k 1 k 1 0,37 0,37(k  1)  => Số C trung bình = (k ≥ 2) neste 0, 08 nCO2 = 0,37 mol , nH2O = 0,29 mol => neste = Dễ thấy, với k ≥ => C trung bình ≥ 9,25 , khơng có đáp án => k = , C trung bình = 4,625 => Este C4H6O2 C5H8O2 Câu 16: Đáp án : B Ta có: nCa(OH)2 = 0,04 mol ; nCaCO3 = 0,03 mol => Dung dịch tạo thành chứa muối => nCO2 = nOH- - nCaCO3 = 0,08 – 0,03 = 0,05 mol m dung dịch tăng = 0,1 g => mCO2 + mH2O = 0,1 + = 3,1 g => mH2O = 3,1 – 0,05.44 = 0,9 g => nH2O = 0,05 mol => Hai este no, hở, đơn chức Số C trung bình = 0, 05 = 3,54 0, 014 => Este C3H6O2 C4H8O2 Câu 17: Đáp án : C Khi đốt m/2 (g) este giống đốt hỗn hợp X, tạo b (g) CO2 => Đốt m (g) este tạo 2b (g) CO2 Mà nCO2 = nH2O => 2b a 11a  �b 44 18 Câu 18: Đáp án : D Ta thấy: C17H31COOH + 2H2 (axit linoleic) o Ni ,t ��� � C17H35COOH (axit stearic) Câu 19: Đáp án : A C6H5OOCCH2COOCH3 + 3KOH  C6H5OK + KOOCCH2COOK + CH3OH + H2O => mKOH = 56 19, 194 = 16,8 (g) Câu 20: Đáp án : B nCO2  nH 2O a b  k 1 44 18 a b 10a 20b => mNaOH = neste 40 x = 40.(  )  44 18 11 Este có độ bất bão hòa k = => neste =  Câu 21: Đáp án : C Phát biểu C sai Chất béo tạo thành có chứa axit béo chưa no => Tồn trạng thái lỏng Câu 22: Đáp án : B Chỉ số axit là: 0, 02.56.1000 =5 40.5, Câu 23: Đáp án : B Nhận thấy rằng: +) Thủy phân HCOOC3H7 , tạo C3H7OH (2 đồng phân) +) Thủy phân HCOOC4H9 , tạo C4H9OH (4 đồng phân) => Sản phẩm chứa muối (HCOONa) ancol, thỏa mãn Câu 24: Đáp án : D Gọi số mol panmitin stearin x y Coi đơn vị cho gam (thay kg) 806 x  890 y  42,82 � �x  0, 02 � �� Ta : � 4,6 x y  �y  0, 03 � 92 � 0, 02.806 => % m panmitin = = 37,65 % 42,82 => % stearin = 62,35 % Câu 25: Đáp án : B Có phản ứng xảy ra: 3NaOH + (RCOO)3C3H5  3RCOONa + C3H5(OH)3 (1) NaOH + R'COOH  R'COONa + H2O (2) Ta coi đơn vị gam (thay kg) nNaOH = 0,061 mol , nglyxerol = 0,02 mol => nNaOH (2) = 0,061 - 0,02.3 = 10-3 => mH2O = 10-3 18 = 0,018 g BTKL => 2,44 + m chất béo = 17,202 + 1,84 + 0,018 => m chất béo = 16,62 g m chất béo = 16,62 kg (đổi lại đơn vị) Câu 26: Đáp án : B Số trieste tối đa là: n (n  1) 9.4 = 18  2 Câu 28: Đáp án : A Có phản ứng xảy ra: Triolein + Br2  (C17H33Br2COO)3C3H5 Vinylaxetat + Br2  CH3COOC2H3Br2 Triolein + NaOH  Xà phòng + glyxerol Vinyaxetat + NaOH  CH3COONa + CH3CHO Câu 29: Đáp án : C Các axit béo thường gặp axit cacboxylic đơn chức, mạch dài khơng phân nhánh, có số chẵn nguyên tử cacbon => Axit béo không no Câu 30: Đáp án : A Thủy phân CH3COOCH2CH2OOCCH3 , tạo C2H4(OH)2 mà phân tử etylenglycol hòa tan phân tử Cu(OH)2 => m = 98 = 1,34 g 146 Câu 31: Đáp án : D Các đồng phân bền có CTPT C2H4O2 là: CH3COOH ; HCOOCH3 ; HO-CH2-CHO CH3COOH có phản ứng với Na, NaOH, Na2CO3 HCOOCH3 có phản ứng với NaOH , AgNO3/NH3 HO-CH2-CHO có phản ứng với Na ; AgNO3/NH3 => Có phản ứng xảy Câu 32: Đáp án : A CH 3COOR � �ROH + NaOH  � + CH3COONa � CH 3COOR ' �R ' OH � nCH3COONa = 0,06 mol => n ancol = 0,06 mol => n andehit = 0,06 mol 17, 28 = 0,16 mol => andehit phải chứa HCHO 108 nHCHO = nAg - n andehit = 0,08 - 0,06 = 0,02 mol Mà nAg = => nCH3OH = 0,02 mol ; n andehit lại = 0,04 mol Mà mA + mB = 5,56 => 0,02.(59 + 15) + 0,04.(59 + R') = 5,56 => R' = 43 (C3H7-) Do đó,khi đốt 0,02 mol CH3COOCH3 0,04 mol CH3COOC3H7 tạo nCO2 = nH2O = 0,26 mol => mCO2 + mH2O = 16,12 g => Đáp án A Câu 33: Đáp án : B nNaOH = 32.0, 25 = 0,2 mol = n este => Este chức 40 M ancol = 22,5 = 45 => Một ancol CH3OH (32) => Ancol lại M = 45.2 - 32 = 58 (CH2=CH-CH2OH) Đốt 0,1 mol este tạo 0,7 mol CO2 => Este có nguyên tử C => Este CH3OOCCH2COOCH2CH=CH2 Câu 34: Đáp án : A 3KOH + (RCOO)3C3H5 3RCOOK + C3H5(OH)3 (1) KOH + R'COOH R'COOK + H2O (2) 103.36, 4.10 3 = 2,6 mol 56 7,366.103 => nKOH (1) =  2, 56 nKOH (2) = BTKL : mKOH + mCB = m xà phòng + mC3H5(OH)3 + mH2O 7,366 + 36,4 = mxà phòng + (nKOH (1) 92 + nKOH (2).18).10-3 mxà phòng = 39,765 kg Câu 35: Đáp án : D Theo đề A = B - 14 = C - 28 (hơn -CH2-) Ta có: dA,C/H2 = 47,5 => M A  3M C = 47,5 MA + 3MC = 380 , mà MA = MC - 28 => MA = 74 (C3H6O2) => B C4H8O2 , đốt 0,2 mol B tạo thành nCO2 = nH2O = 0,8 mol => m bình tăng = 0,8.(18 +44) =49,6 g Câu 38: Đáp án : C nNaOH = 0,6 mol = 3neste => Este chức => Trong muối tạo có muối chiếm 0,2 mol ; muối chiếm 0,4 mol Gọi muối RCOONa ; R'COONa => 0,2.(R + 67) + 0,4.(R' + 67) = 54,8 R + 2R' = 73 => R =15 (CH3) ; R' = 29 (C2H5) Câu 39: Đáp án : A HOCH2CH2COOCH2CH2COOCH3 + 2NaOH  2HOCH2CH2COONa + CH3OH Câu 40: Đáp án : A nH2 = 0,05 mol => nancol = 0,1 mol Mà nNaOH = 0,2 mol => Hỗn hợp chứa axit este naxit = 0,1 mol ; neste = 0,1 mol n muối = 0,2 mol => M muối = 16, = 82 (CH3COONa) 0, Gọi este CH3COOOR => -,1.60 + 0,1.(59 + R) = 13,4 => R = 15 (CH3) Vậy hỗn hợp chứa : 0,1 mol CH3COOH 0,1 mol CH3COOCH3 => % mCH3COOH = 44,78% % mCH3COOCH3 = 55,22 % Câu 41: Đáp án : B Phát biểu B không Este tạo thành thay nhóm -OH -COOH axit cacboxylic gốc hidrocacbon: R-CO-OH + H-O-R' → RCOOR' + H2O Câu 42: Đáp án : A Este tạo este no, đơn chức, mạch hở => CTTQ: CnH2nO2 Axit nhỏ thỏa mãn có 1C Ancol bậc nhỏ thỏa mãn có 4C: C(OH)(CH3)3 Do n ≥ => Este: CnH2nO2 (n ≥ 5) Câu 43: Đáp án : A Theo thì: P2O5 hấp thụ H2O=> khối lượng bình tăng khối lượng nước => nH2O = 0,345 mol +) Ca(OH)2 hấp thụ CO2 => nCO2 = 0,345 mol Nhận thấy : nCO2 = nH2O => Este phải no, đơn chức, mạch hở Câu 44: Đáp án : A Este có 2O => Este đơn chức Oxi hóa Y thành anđehit nên Y ancol đơn chức => Y1 anđehit đơn chức Mà 1Y1 → 4Ag => Y1 HCHO => Este: CH3CH2COOCH3 (metyl propionat) Câu 45: Đáp án : D Từ sơ đồ => X CH3COOCH2CH3:  H 2O , H  CH3COOCH2CH3 ���� � CH3COOH + C2H5OH (Y1) C2H5OH + O2 → CH3COOH (Y2) Câu 46: Đáp án : D Ta ngược từ cuối: (T): C2H5COONa + NaOH CaO ��� � C2H6 + Na2CO3 to (Z): C2H5COOH + NaOH → C2H5COONa + H2O (Y): C2H5CH2OH + O2 → C2H5COOH + H2O (X): HCOOCH2CH2CH3 + NaOH → HCOONa + CH3CH2CH2OH Câu 47: Đáp án : C Este C4H6O4 có k = 2, lại chứa oxi nên este chức => Este là: HCOOCH2CH2OOCH X + 2NaOH → 2HCOONa + HOCH2CH2OH bđ 0,1 0,3 pư 0,1 0,2 0,2 0,1 mol dư 0,1 =>chất rắn gồm HCOONa NaOH dư => Chất rắn = 0,2.68 + 0,1 40 = 17,6 g (hay áp dụng bảo toàn khối lượng=> chất rắn = 0,1.118 + 0,3.40 – 0,1.62 = 17,6 (g)) Câu 48: Đáp án: C Gọi X RCOOH => RCOOH + C2H5OH �� � RCOOC2H5 + H2O Gọi số mol este x => naxit dư = 0,3 - x mol nancol dư = 0,25 - x mol Cứ mol RCOOH C2H5OH tạo => 0,5.(0,3 - x) + 0,5.(0,25 - x) = 2,128 22, H2 phản ứng với Na => x = 0,18 mol => Meste = 18 = 100 => RCOOC2H5 = 100 0,18 => R = 27 (CH2=CH-) Axit CH2=CH-COOH Hiệu suất = neste 0,18  = 72% (vì ancol hết - theo lí thuyết) nancol 0, 25 Câu 49: Đáp án: B CH2=C(CH3)COOH + CH3OH Vì hiệu suất đạt 80 % 100 Maxit M este 100 nancol = Mancol M este => naxit = �� � CH2=C(CH3)COOCH3 + H2O 100 = 86 0,8 100 100 = 32 0,8 100 = 107,5 kg 0,8 = 40 kg 0,8 Câu 50: Đáp án: D Gọi số mol axit ancol phần x y H2 C2H5OH + K �� � H2 1 => x+ y = 0,15 2 1 CH3COOH + Na2CO3 �� � CH3COONa + CO2 + H2O 2 => y = nCO2 = 0,05 �x  0, => � => Khi este hóa, ancol phản ứng hết (theo lí thuyết) �y  0,1 CH3COOH + K �� � Vì hiệu suất 60% => n este = 0,6.0,1 = 0,06 mol => meste = 0,06.88 = 5,28g Câu 51: Đáp án: A Gọi CT axit : CxHyO2 y - 1)O2 �� � CO2 + H2O y nO2 phản ứng = x + - = 3,5 => 4x + y = 18 CxHyO2 + (x + => x = 3, y = , axit C3H6O2 Ancol Y có dY/O2 < => MY < 2.32 = 64 nX = 7, = 0,1 mol => nH2O (trong phản ứng este hóa) = 0,1 mol 74 Bảo tồn khối lượng : mX + mY = mZ + mH2O => mY = 8,7 + 0,1.18 - 7,4 = 3,1 3,1 = 31 => loại 0,1 3,1 Nếu Y chức => nY = 0,05 => MY = = 62 (CH2OH-CH2OH) 0, 05 Nếu Y đơn chức => nY = 0,1 => MY = Nếu Y có nhiều chức MY > 64 => loại Vậy Z CH3CH2COOCH2CH2OOCCH2CH3 Câu 52: Đáp án: B 12, = 0,2 mol 62 Ta có: Ancol + Axit �� � Este + H2O nancol = Vì ancol chức => nH2O = naxit = 2nancol = 0,4 mol Bảo toàn khối lượng: mancol + maxit = meste + mH2O => maxit = 32 + 0,4.18 - 12,4 = 26,8g => M axit = 26,9 = 67 => Axit CH3COOH (60) C2H5COOH (74) 0, Câu 53: Đáp án: C nNaOH = 19, 48.1.12.0,11 = 0,06 mol 40 Gọi rượu R1OH R2OH => este R1OOCOOR1 ; R2OOCCCOOR1; R2OOCCOOR2 Vì số mol este => Gọi E R1OOCCOOR2 R1OOCCOOR2 + 2NaOH NaOOCCOONa + R1OH + R2OH => neste = 4,8 nNaOH =0,03 => R1 + 44 + 44 + R2 = 0, 03 => R1 + R2 = 72 Mà rượu => R2 - R1 = 14 (Giả sử R2 > R1) => R1 = 29 ; R2 = 43 (C2H5- C3H7-) Câu 54: Đáp án: A Vì nH2O > nCO2 => Ancol no, đơn chức Khi đốt axit tạo nH2O = nCO2 , nancol = 0,4 - 0,3 = 0,1 mol Gọi ancol CnH2n+2O ; axit CmH2mO2, số mol axit x => 0,1n  xm  0,3(1) � � (14 x  18).0,1  (14 m  32) x  7, 6(2) � (2) x = 0,05 => 0,1n + 0,05m = 0,3 2n + m = Mà m ≠ n => n = 1; m = => Ancol CH3OH ; axit C3H7COOH C3H7COOH + CH3OH �� � C3H7COOCH3 + H2O Vì H = 80% => neste = 0,05.0,8 = 0,04 mol (do axit hết) => meste = 0,04.102 = 4,08 g Câu 55: Đáp án C Este thu este no, đơn chức mạch hở Khi đốt este thu nH 2O  nCO2 Do số C không đổi phần nên nH 2O  0,3 � mH 2O  5, Câu 56: Đáp án A Coi hỗn hợp X gồm HCOOH, CH3COOH C2H5COOH (tỉ lệ 5:1:1)thành RCOOH với MRCOOH = =52 → MR = nX = 5, = 0,1 mol 52 PTPU RCOOH + C2H5OH ↔ RCOOC2H5 + H2O Do nX = 0,1 mol < nC2H5OH = 0,125 mol → neste = 0,1× 0,8 = 0,08 (mol) → meste = 0,08 × ( + 44 + 29)= 6,4 gam Câu 57: Đáp án: C Gọi số mol triolein, tripanmitin, tristearin 2x; x; 2x Ta có: Triglyxerit + 3NaOH � 3muối + C3H5(OH)3 ntriglyxerit = 2x + x + 2x => nC3H5(OH)3 = 5x Do đó, 5x.92 = 138 => x = 0,3 mol => m = 884.0,6 + 806.0,3 + 890.0,6 = 1306,2 g Câu 58: Đáp án: C Giả sử có 100g chất béo => mC17H33COOH = 4,23 g; mC15H31COOH = 1,6 g; m(C17H33COO)3C3H5 = 94,17g Để phản ứng hết với 100g chất béo cần: nKOH = nC17H33COOH + nC15H31COOH + 3n(C17H33COO)3C3H5 = 4, 23 1, 94,17   = 0,3408 mol 282 256 884 => mKOH = 19,085 g = 19085 mg => Chỉ số xà phòng hóa là: 19085 = 190,85 100 46.5  60.1  74.1 Câu 59: Đáp án: B Xà phòng hóa chất béo cần mKOH = 1.106 1, 68  0,168.106 g  0,168T 10 Để tiện tính tốn, ta coi : Xà phòng hóa g chất béo cần 0,168g KOH (RCOO)3C3H5 + 3NaOH � 3RCOONa + C3H5(OH)3 nNaOH = nKOH = 0,168  3.103 mol 56 => nC3H5(OH)3 = 10-3 mol Bảo toàn khối lượng => + 3.10-3.40 = mRCOONa + 10-3.92 => mRCOONa = 1,028 g => Khối lượng xà phòng 72% là: 1, 028 = 1,428 0, 72 Câu 60 B Nguyên nhân làm dầu mỡ bị ôi thiu liên kết πC=C bị oxi hóa chậm oxi khơng khí tạo thành peoxit, chất bị phân hủy thành sản phẩm có mùi khó chịu → (1) Các triglixerit chứa chủ yếu gốc axit béo no thường chất rắn nhiệt độ thường → (2) sai Phản ứng thủy phân este axit thuận nghịch, phản ứng thủy phân môi trường kiềm phản ứng chiều → (3) Các axit tồn liên kết hidro, este không chứa liên kết hidro nên este có nhiệt độ sơi thấp axit có số nguyên tử cacbon → (4) sai Chất béo trieste glixerol axit béo → chất béo hợp chất không phân cực , không tan nước tan nhiều dung môi hữu → (5) Phản ứng thủy phân este môi trường kiềm phản ứng xà phòng hóa → (6) Câu 61: C Etyl propionat hợp chất không liên kết hidro chất có nhiệt độ sơi thấp → nhiệt độ sôi T < X, Y, Z Do có nhóm CO hút e phân tử nên X, Y có độ bền liên kết hidro lớn ancol Z → nhiệt độ sôi Z < X, Y Do MX > MY → nên nhiệt độ sôi X>Y Thứ tự nhiệt độ sôi chất T< Z< Y< X Câu 62: C Chọn axit có C32 = cách chọn Có cách xếp trieste tạo axit A,B glixerol ( A-A-B, A-B-A, B-B-A, B-A-B) Số loại trieste tạo thành chứa hai gốc axit số ba axit béo : 4= 12 Câu 63: B Các chất dãy thủy phân dung dịch NaOH loãng (dư), đun nóng sinh ancol là: metyl benzoat, metyl metacrylat, anlyl axetat, metyl axetat, etyl fomat, triolein, tristearin Vậy có chất Đáp án B Câu 64: Đáp án B X etyl axetat CH3COOC2H5 + H2O � CH3COOH + C2H5OH CH3CH2OH + O2 o xt ,t ��� � CH3COOH + H2O Câu 65: Đáp án B CaO ,t o Muối Y + NaOH ��� � CH2=CH2 Mà Y có CTPT C4H6O2 → X CH2=CHCOONa → Y CH2=CHCOOCH3 → Chọn B CH2=CHCOOCH3 + NaOH → CH2=CHCOONa (Y) + CH3OH CH2=CHCOONa + NaOH o CaO ,t ��� � CH2=CH2 + Na2CO3 ... phản ứng vừa đủ thu ancol 16,4 gam muối Toàn lượng ancol phản ứng với Na dư thu 1,12 lít khí H2 ( đktc) % theo khối lượng chất hỗn hợp là: A 55,22% 44,78% B 45,25% 54,75% C 53,22% 46,78% D 50% 50%... thấy có 3,36 lít khí + Phần tác dụng với Na2CO3 dư thấy có 1,12 lít khí CO2 Các thể tích khí đo đktc + Phần thêm vào vài giọt dung dịch H2SO4, sau đun sơi hỗn hợp thời gian Biết hiệu suất phản
- Xem thêm -

Xem thêm: KIỂM TRA CHƯƠNG ESTE LIPIT LỚP 12 CHƯƠNG TRÌNH CHUẨN HÓA HỌC TRUNG HỌC PHỔ THÔNG, KIỂM TRA CHƯƠNG ESTE LIPIT LỚP 12 CHƯƠNG TRÌNH CHUẨN HÓA HỌC TRUNG HỌC PHỔ THÔNG

Gợi ý tài liệu liên quan cho bạn

Nhận lời giải ngay chưa đến 10 phút Đăng bài tập ngay