De khao sat chat luong

12 29 0
  • Loading ...
1/12 trang

Thông tin tài liệu

Ngày đăng: 16/04/2018, 15:45

Trường THPT:THPT CHUYÊN NQD Người sọan: Phan Ngọc Tiến Số điện thoại:0939753298 SỞ GDĐT ĐỒNG THÁP TRƯỜNG THPT CHUYÊN NQD (Đề thi có trang) ĐỀ THI THAM KHẢO THPTQG NĂM 2018 MƠN HĨA HỌC Thời gian làm bài:50.phút Câu 1: Kim loại có nhiệt độ nóng chảy cao nhất A Cu B Au C Cr D W 2− Câu 2: Một mẫu nước cứng chứa ion: Mg 2+, Ca2+, Cl − , SO Chất dùng để làm mềm mẫu nước cứng A BaCl2 B NaHCO3 C Na3PO4 D Ca(OH)2 Câu 3: Tác nhân chủ yếu gây mưa axit A CO CH4 B CH4 NH3 C SO2 NO2 D CO CO2 Câu 4: Este sau thủy phân tạo sản phẩm tham gia phản ứng tráng gương A HCOOCH3 B CH2=CHCOOCH3 C HCOOCH=CH2 D CH3COOCH2CH=CH2 Câu 5: Trong loại quặng sắt, quặng có hàm lượng sắt cao nhất A hematit nâu B manhetit C xiđerit D hematit đỏ Câu 6: Chất hữu sau dùng để sản xuất tơ tổng hợp? A PoliStiren B Poli(Vinyl xianua) C PoliIsopren D Poli(metyl metacrylat) Câu 7: Dãy gồm chất vừa tác dụng với dung dịch axit vừa tác dụng với dung dịch kiềm? A AlCl3 Al2(SO4)3 B Al(NO3)3 Al(OH)3 C Al2(SO4)3 Al2O3 D Al(OH)3 Al2O3 Câu 8: Các số oxi hoá đặc trưng crom là: A +2; +4, +6 B +2, +3, +6 C +1, +2, +4, +6 D +3, +4, +6 Câu 9: Dung dịch sau có pH < 7? A Na2SO4 B Al2(SO4)3 C K2CO3 D CH3COONa Câu 10: Trong phản ứng hoá học sau đây, phản ứng không xảy ? A SiO2 + 4HF → SiF4 + 2H2O B SiO2 + 4HCl → SiCl + 2H2O t C SiO2 + 2C  → Si + 2CO t D SiO2 + 2Mg  → Si + 2MgO Câu 11: Cặp chất sau đồng phân ? A C2H5OH CH3-O-CH2-CH3 B CH3–O-CH3 CH3-CHO C CH3-CH2–CHO CH3-CHOH-CH3 D CH2=CH-CH2OH CH3-CH2-CHO Câu 12: Cho hợp chất thơm : ClC6H4CH2Cl + dung dịch KOH (đặc, dư, to, p) ta thu chất nào? A KOC6H4CH2OK B HOC6H4CH2OH C ClC6H4CH2OH D KOC6H4CH2OH Câu 13: Cho mợt luồng khí CO qua ống đựng 10 gam Fe 2O3 nung nóng.Sau một thời gian thu m gam hổn hợp X gồm oxit sắt.Cho X tác dụng hết với dd HNO vừa đủ thu dung dịch Y 1,12 lít NO (đktc) nhất Vậy m có giá trị A 7,5 B 8,8 C D Câu 14: Cho 200 ml dung dịch AlCl 31,5M tác dụng với V lít dung dịch NaOH 0,5M, lượng kết tủa thu 15,6 gam Giá trị lớn nhất V A 1,2 B 1,8 C 2,4 D Trang 1/12 - Mã đề thi 689 Câu 15: Bố trí thiết bị hình vẽ dùng để điều chế mợt số khí phòng thí nghiệm Ba khí có thể điều chế theo hình vẽ đó A CO2, H2, C2H2 B H2, C2H4, CO2 C N2, H2, NH3 D O2, CO2, C2H4 Câu 16: Phát biểu sau sai? A Thủy phân vinyl axetat thu andehit axetic B Etyl fomat có phản ứng tráng bạc C Triolein phản ứng với nước brom D Ở điều kiện thường, tristearin chất lỏng Câu 17: Thủy phân hoàn toàn triglixerit X dung dịch NaOH dư, thu 4,6 gam glixerol m gam hỗn hợp hai muối natri stearat natri oleat có tỉ lệ mol tương ứng : Giá trị m A 45,6 gam B 45,8 gam C 45,7 gam D 45,9 gam Câu 18: Đốt cháy hồn tồn mợt amin đơn chức X thu 8,4 lít khí CO 2, 1,4 lít khí N2 (các thể tích khí đo đktc) 10,125 gam H2O Công thức phân tử X (cho H = 1, O = 16) A C3H7N B C3H9N C C4H9N D C2H7N Câu 19: Hỗn hợp X chứa mol NH mol O2 Cho X qua Pt (xt) đun 900 0C, thấy có 90% NH3 bị oxi hóa Lượng O2 dư là: A 2,75 mol B 3,50 mol C 1,00 mol D 2,50 mol Câu 20: Cho chất sau: vinyl fomat, triolein, tinh bột, anilin, Gly-Ala-Gly, protein Số chất tham gia phản ứng thủy phân môi trường kiềm A B C D Câu 21: Cho phát biểu sau: (a) Điện phân dung dịch NaCl (điện cực trơ), thu khí Cl2 catot (b) Cho CO dư qua hỗn hợp Fe2O3 CuO đun nóng, thu Fe Cu (c) Nhúng Zn vào dung dịch chứa CuSO4 H2SO4, có xuất hiện ăn mòn điện hóa (d) Kim loại dẻo nhất Au, kim loại dẫn điện tốt nhất Ag (e) Cho dung dịch AgNO3 dư vào dung dịch FeCl2, thu chất rắn gồm Ag AgCl Số phát biểu A B C D Câu 22: Cho phương trình hóa học sau xảy theo tỉ lệ mol: t° X + 4NaOH  → Y + Z + T + 2NaCl + H2O Y + 2AgNO3 +3NH3 + H2O → C2H4NO4Na +2Ag + 2NH4NO3 Z+ HCl → C3H6O3 + NaCl t° T+ ½.O2  → C2H4O2 Biết X không phân nhánh Công thức cấu tạo X A CH3CH2COOCH(Cl)COOC(Cl)=CH2 B CH3CH(Cl)COOCH2COOC(Cl)=CH2 C CH3CH(Cl)COOCH(Cl)COOC2H3 D HOCH2COOCH(Cl)COOCH(Cl)CH3 Câu 23: Cho 14,2 gam P2O5 vào 200 gam dung dịch NaOH 8% thu dung dịch X Muối thu nồng độ % tương ứng A NaH2PO4 11,2% B Na3PO4 7,66% C Na2HPO4 13,26% D Na2HPO4 NaH2PO4 7,66% Trang 2/12 - Mã đề thi 689 Câu 24: Hỗn hợp X chứa chất A (C5H16O3N2) chất B (C4H12O4N2) tác dụng với dung dịch NaOH vừa đủ, đun nóng phản ứng xảy hồn tồn cạn thu m gam hỗn hợp Y gồm muối D E (MD < ME) 4,48 lít (đktc) hỗn hợp Z gồm amin no, đơn chức, đồng đẳng có tỉ khối so với H2 18,3 Khối lượng muối E hỗn hợp Y là: A 4,24 B 3,18 C 5,36 D 8,04 Câu 25: Hòa tan hồn tồn Fe3O4 H2SO4 lỗng, dư thu dung dịch X Cho dung dịch X phản ứng với chất: Cu, Ag, dung dịch KMnO 4, Cl2, dung dịchAgNO3, dung dịch KNO3 Số chất có phản ứng xảy với dung dịch X A B C D Câu 26: Ancol etylic điều chế từ tinh bột phương pháp lên men với hiệu śt tồn bợ q trình 80%, hấp thụ tồn bợ lượng CO sinh lên men m gam tinh bột vào nước vôi trong, thu 330 gam kết tủa dung dịch X Biết khối lượng X giảm so với khối lượng nước vôi ban đầu 132 gam Gía trị m : A 455,6 B 324,5 C 486,9 D 297,8 Câu 27: Một bột màu lục A thực tế không tan dung dịch loãng axit kiềm Khi nấu chảy với kiềm có mặt khơng khí nó chuyển thành chất B có màu vàng dễ tan nước, chất B tác dụng với axit chuyển thành chất C có màu da cam Chất C bị lưu huỳnh khử thành chất A oxi hố axit clohiđric thành khí clo Cơng thức phân tử chất A, B C : A Cr2O3, Na2CrO4, K2Cr2O7 B Cr2O3, K2CrO4, K2Cr2O7 C Cr2O3, Na2Cr2O7, Na2CrO4 D Cr2O3, K2CrO4, Na2Cr2O7 Câu 28: Kết quả thí nghiệm dung dịch X, Y, Z, T với thuốc thử ghi bảng sau: Mẫu thử Thuốc thử Hiện tượng X Dung dịch AgNO3 NH3,t Kết tủa Ag Y Quỳ tím Chuyển màu xanh Z Cu(OH)2, nhiệt đợ thường Màu xanh lam T Nước brom Kết tủa trắng Các dung dịch X, Y, Z, T là: A metanal, anilin, glucozơ, phenol B Etyl fomat, lysin, saccarozơ, anilin C glucozơ, alanin, lysin, phenol D axetilen, lysin, glucozơ, anilin Câu 29: Cho nhận xét sau: Trong điện phân dung dịch NaCl catot xẩy oxi hoá nước Khi nhúng Fe vào dung dịch hỗn hợp CuSO4 H2SO4 bản Fe bị ăn mòn điện hố Trong thực tế để loại bỏ NH3 phòng thí nghiệm ta phun khí Cl2 vào phòng Khi cho thêm CaCl2 vào nước cứng tạm thời thu nước cứng toàn phần Nguyên tắc để sản xuất gang khử quặng sắt oxit than cốc lò cao Sục H2S vào dung dịch hỗn hợp FeCl3 CuCl2 thu loại kết tủa Số nhận xét là: A B C D Câu 30: Hỗn hợp X gồm metan, propen isopren Đốt cháy hồn tồn 15,0 gam X cần vừa đủ 36,96 lít O2 (đktc) Mặt khác, a mol X phản ứng tối đa với 0,1 mol brom Giá trị a A 0,20 B 0,15 C 0,30 D 0,10 Câu 31: Cho từ từ dung dịch Ba(OH) vào dung dịch chứa a mol Al2(SO4)3 b mol AlCl3 khối lượng kết tủa sinh biểu diễn đồ thị sau Giá trị (x + y + a + b) gần với giá trị nhất sau đây? mkt (gam) 8,55 m số mol Ba(OH)2 A 0,0895 x y B 0,0845 C 0,0865 0,08 D 0,0755 Trang 3/12 - Mã đề thi 689 Câu 32: Cho chất sau: etan, poli etilen, axetilen, isopren, benzen, toluen, stiren, phenol, alanin, vinyl axetat Số chất tác dụng với nước brom điều kiện thường A B C D Câu 33: Điện phân (với điện cực trơ, màng ngăn xốp) dung dịch X chứa CuSO NaCl (có tỉ lệ mol tương ứng 1: 3) dòng điện mợt chiều có cường đợ 2,68A, sau thời gian t thu dung dịch Y chứa hai chất tan thấy khối lượng dung dịch Y giảm 27,525 gam so với khối lượng dung dịch X Cho bột nhôm dư vào dung dịch Y, sau phản ứng xảy hoàn toàn thu 5,04 lít khí H2 (đktc) Giá trị t gần với A 5,5 B 4,5 C 5,0 D 6,5 Câu 34: X este mạch hở có công thức phân tử C5H8O2; Y Z hai este (đều no, mạch hở, tối đa hai nhóm este, MY < MZ) Đốt cháy hoàn toàn 0,2 mol hỗn hợp E gồm X, Y Z, thu 15,68 lít CO2 (đktc) Mặt khác, cho E tác dụng với dung dịch NaOH vừa đủ, thu hỗn hợp hai ancol có số cacbon hỗn hợp hai muối Phân tử khối Z A 74 B 118 C 88 D 132 Câu 35: Cho m gam hỗn hợp X gồm Ba, BaO, Al vào nước thu 3,024 lít khí (đktc), dung dịch Y chất rắn khơng tan Z Cho tồn bợ Z vào dung dịch CuSO dư, kết thúc thí nghiệm thu dung dịch có khối lượng giảm 1,38 gam Cho từ từ 55 ml dung dịch HCl 2M vào Y thu 5,46 gam chất rắn Giá trị m A 8,20 gam B 7,21 gam C 8,58 gam D 8,74 gam Câu 36: Hỗn hợp X gồm mol amin no mạch hở A mol aminoaxit no mạch hở B tác dụng vừa đủ với mol HCl hay mol NaOH Đốt a gam hỗn hợp X cần 46,368 lít O (đktc) thu 8,064 lít khí N2 (đktc) Nếu cho a gam hỗn hợp tác dụng với dung dịch HCl dư thu gam muối? A 75,52 B 84,96 C 89,68 D 80,24 Câu 37: Hòa tan hồn tồn 216,55 gam hỗn hợp KHSO Fe(NO3)3 vào nước dung dịch X 64 m Y ) tan hết vào X Sau Cho m gam hỗn hợp Y gồm Mg, Al, MgO, Al 2O3 (trong đó m O = 205 phản ứng kết thúc, thu dung dịch Z chứa muối trung hòa 2,016 lít (đktc) hỗn hợp khí T có tổng khối lượng 1,84 gam (trong đó H chiếm 4/9 thể thích nguyên tố oxi chiếm 8/23 khối lượng hỗn hợp) Cho BaCl2 dư vào Z thu 356,49 gam kết tủa Giá trị m A 20,0 B 22,0 C 22,5 D 20,5 Câu 38: Hỗn hợp E gồm pentapeptit X, hexapeptit Y, Val-Ala (trong X, Y chứa cả Ala, Gly, Val số mol Val-Ala 1/4 số mol hỗn hợp E) Cho 0,2 mol hỗn hợp E tác dụng vừa đủ với dung dịch chứa 0,95 mol NaOH, thu hỗn hợp muối Ala, Gly, Val Mặt khác đốt cháy hoàn toàn 139,3 gam E, thu tổng khối lượng CO H2O 331,1 gam Phần trăm khối lượng Y hỗn hợp E gần với giá trị sau đây? A 60% B 64% C 68% D 62% Câu 39: Hòa tan hồn toàn 13,12 gam hỗn hợp Cu, Fe Fe 2O3 240 gam dung dịch HNO 7,35% H2SO4 6,125% thu dung dịch X chứa 37,24 gam chất tan gồm muối thấy khí NO (NO sản phẩm khử nhất) Cho Ba(OH) dư vào dung dịch X, lấy kết tủa nung nóng khơng khí đến phản ứng hồn tồn thu 50,95 gam chất rắn Dung dịch X hòa tan tối đa m gam Cu Giá trị m A 2,56 B 2,88 C 3,20 D 3,52 Câu 40: Đốt cháy X Y với lượng oxi vừa đủ, thu CO có số mol số mol O2 phản ứng Biết X, Y (M X < MY) hai este mạch hở, không phân nhánh không chứa nhóm chức khác Đun nóng 30,24 gam hỗn hợp E chứa X, Y (số mol X gấp 1,5 lần số mol Y) cần dùng 400 ml dung dịch KOH 1M, thu hỗn hợp F chứa ancol hỗn hợp chứa muối Dẫn tồn bợ F qua bình đựng Na dư thấy khối lượng bình tăng 15,2 gam Đốt cháy hồn toàn hỗn hợp muối cần dùng 0,42 mol O2 Tổng số nguyên tử có Y A 19 B 20 C 22 D 21 Trang 4/12 - Mã đề thi 689 GỢI Ý GIẢI Câu 1: Kim loại có nhiệt độ nóng chảy cao nhất A Cu B Au C Cr 2+ 2+ D W 2− Câu 2: Một mẫu nước cứng chứa ion: Mg , Ca , Cl − , SO Chất dùng để làm mềm mẫu nước cứng A BaCl2 B NaHCO3 C Na3PO4 D Ca(OH)2 Câu 3: Tác nhân chủ yếu gây mưa axit A CO CH4 B CH4 NH3 C SO2 NO2 D CO CO2 Câu 4: Este sau thủy phân tạo sản phẩm tham gia phản ứng tráng gương A HCOOCH3 B CH2=CHCOOCH3 C HCOOCH=CH2 D CH3COOCH2CH=CH2 Câu 5: Trong loại quặng sắt, quặng có hàm lượng sắt cao nhất A hematit nâu B manhetit C xiđerit D hematit đỏ Câu 6: Chất hữu sau dùng để sản xuất tơ tổng hợp? A PoliStiren B Poli(Vinyl xianua) C PoliIsopren D Poli(metyl metacrylat) Câu 7: Dãy gồm chất vừa tác dụng với dung dịch axit vừa tác dụng với dung dịch kiềm? A AlCl3 Al2(SO4)3 B Al(NO3)3 Al(OH)3 C Al2(SO4)3 Al2O3 D Al(OH)3 Al2O3 Câu 8: Các số oxi hoá đặc trưng crom là: A +2; +4, +6 B +2, +3, +6 C +1, +2, +4, +6 D +3, +4, +6 Câu 9: Dung dịch sau có pH < 7? A Na2SO4 B Al2(SO4)3 C K2CO3 D CH3COONa Câu 10: Trong phản ứng hoá học sau đây, phản ứng không xảy ? A SiO2 + 4HF → SiF4 + 2H2O B SiO2 + 4HCl → SiCl + 2H2O t C SiO2 + 2C  → Si + 2CO t D SiO2 + 2Mg  → Si + 2MgO Câu 11: Cặp chất sau đồng phân ? A C2H5OH CH3-O-CH2-CH3 B CH3–O-CH3 CH3-CHO C CH3-CH2–CHO CH3-CHOH-CH3 D CH2=CH-CH2OH CH3-CH2-CHO Câu 12: Cho hợp chất thơm : ClC6H4CH2Cl + dung dịch KOH (đặc, dư, to, p) ta thu chất nào? A KOC6H4CH2OK B HOC6H4CH2OH C ClC6H4CH2OH D KOC6H4CH2OH Câu 13: Cho mợt luồng khí CO qua ống đựng 10 gam Fe 2O3 nung nóng.Sau một thời gian thu m gam hổn hợp X gồm oxit sắt.Cho X tác dụng hết với dd HNO vừa đủ thu dung dịch Y 1,12 lít NO (đktc) nhất Vậy m có giá trị A 7,5 B 8,8 C D HD Ta có BT e => nCO= nCO2 = 0,05.3/2 = 0,075 => BTKL m = 10 + 0,075.28 – 0,075.44 = 8,8 gam Câu 14: Cho 200 ml dung dịch AlCl 31,5M tác dụng với V lít dung dịch NaOH 0,5M, lượng kết tủa thu 15,6 gam Giá trị lớn nhất V A 1,2 B 1,8 C 2,4 D HD Số mol NaOH = 0,3.3 + (0,3-0,2) = mol => V = 1/05 = lít Trang 5/12 - Mã đề thi 689 Câu 15: Bố trí thiết bị hình vẽ dùng để điều chế mợt số khí phòng thí nghiệm Ba khí có thể điều chế theo hình vẽ đó A CO2, H2, C2H2 B H2, C2H4, CO2 C N2, H2, NH3 D O2, CO2, C2H4 Câu 16: Phát biểu sau sai? A Thủy phân vinyl axetat thu andehit axetic B Etyl fomat có phản ứng tráng bạc C Triolein phản ứng với nước brom D Ở điều kiện thường, tristearin chất lỏng Câu 17: Thủy phân hoàn toàn triglixerit X dung dịch NaOH dư, thu 4,6 gam glixerol m gam hỗn hợp hai muối natri stearat natri oleat có tỉ lệ mol tương ứng : Giá trị m A 45,6 gam B 45,8 gam C 45,7 gam D 45,9 gam HD BTKL => m = 886.0,05 + 0,15.40 – 4,6 = 45,7 gam Câu 18: Đốt cháy hồn tồn mợt amin đơn chức X thu 8,4 lít khí CO 2, 1,4 lít khí N2 (các thể tích khí đo đktc) 10,125 gam H2O Công thức phân tử X (cho H = 1, O = 16) A C3H7N B C3H9N C C4H9N D C2H7N HD Số mol nX = nN2 = 0,125 mol => Số C = nCO2/nX = ; Số H = nH/nX = Câu 19: Hỗn hợp X chứa mol NH mol O2 Cho X qua Pt (xt) đun 900 0C, thấy có 90% NH3 bị oxi hóa Lượng O2 dư là: A 2,75 mol B 3,50 mol C 1,00 mol D 2,50 mol HD o C 2NH3 + 2,5O2 Pt,900   → 2NO + 3H2O Câu 20: Cho chất sau: vinyl fomat, triolein, tinh bột, anilin, Gly-Ala-Gly, protein Số chất tham gia phản ứng thủy phân môi trường kiềm A B C D Câu 21: Cho phát biểu sau: (a) Điện phân dung dịch NaCl (điện cực trơ), thu khí Cl2 catot (b) Cho CO dư qua hỗn hợp Fe2O3 CuO đun nóng, thu Fe Cu (c) Nhúng Zn vào dung dịch chứa CuSO4 H2SO4, có xuất hiện ăn mòn điện hóa (d) Kim loại dẻo nhất Au, kim loại dẫn điện tốt nhất Ag (e) Cho dung dịch AgNO3 dư vào dung dịch FeCl2, thu chất rắn gồm Ag AgCl Số phát biểu A B C D Câu 22: Cho phương trình hóa học sau xảy theo tỉ lệ mol: t° X + 4NaOH  → Y + Z + T + 2NaCl + H2O Y + 2AgNO3 +3NH3 + H2O → C2H4NO4Na +2Ag + 2NH4NO3 Z+ HCl → C3H6O3 + NaCl t° T+ ½.O2  → C2H4O2 Biết X không phân nhánh Công thức cấu tạo X A CH3CH2COOCH(Cl)COOC(Cl)=CH2 B CH3CH(Cl)COOCH2COOC(Cl)=CH2 C CH3CH(Cl)COOCH(Cl)COOC2H3 D HOCH2COOCH(Cl)COOCH(Cl)CH3 Trang 6/12 - Mã đề thi 689 Câu 23: Cho 14,2 gam P2O5 vào 200 gam dung dịch NaOH 8% thu dung dịch X Muối thu nồng độ % tương ứng A NaH2PO4 11,2% B Na3PO4 7,66% C Na2HPO4 13,26% D Na2HPO4 NaH2PO4 7,66% HD Số mol H3PO4 = 0,2 : Số mol NaOH = 0,4 => Tạo muối Na2HPO4 Câu 24: Hỗn hợp X chứa chất A (C5H16O3N2) chất B (C4H12O4N2) tác dụng với dung dịch NaOH vừa đủ, đun nóng phản ứng xảy hồn tồn cạn thu m gam hỗn hợp Y gồm muối D E (MD < ME) 4,48 lít (đktc) hỗn hợp Z gồm amin no, đơn chức, đồng đẳng có tỉ khối so với H2 18,3 Khối lượng muối E hỗn hợp Y là: A 4,24 B 3,18 C 5,36 D 8,04 HD A : (C2H5NH3)2CO3 B: (COONH3CH3)2 Câu 25: Hòa tan hồn tồn Fe3O4 H2SO4 loãng, dư thu dung dịch X Cho dung dịch X phản ứng với chất: Cu, Ag, dung dịch KMnO4, Cl2, dung dịchAgNO3, dung dịch KNO3 Số chất có phản ứng xảy với dung dịch X A B C D Câu 26: Ancol etylic điều chế từ tinh bột phương pháp lên men với hiệu śt tồn bợ q trình 80%, hấp thụ tồn bợ lượng CO sinh lên men m gam tinh bột vào nước vôi trong, thu 330 gam kết tủa dung dịch X Biết khối lượng X giảm so với khối lượng nước vôi ban đầu 132 gam Gía trị m : A 455,6 B 324,5 C 486,9 D 297,8 HD Khối lượng dd giảm = 132 = 330 – 44.nCO => nCO2 = 4,5 => m= 2,25.162.100/80 = 455,6g Câu 27: Một bột màu lục A thực tế không tan dung dịch loãng axit kiềm Khi nấu chảy với kiềm có mặt khơng khí nó chuyển thành chất B có màu vàng dễ tan nước, chất B tác dụng với axit chuyển thành chất C có màu da cam Chất C bị lưu huỳnh khử thành chất A oxi hoá axit clohiđric thành khí clo Cơng thức phân tử chất A, B C : A Cr2O3, Na2CrO4, K2Cr2O7 B Cr2O3, K2CrO4, K2Cr2O7 C Cr2O3, Na2Cr2O7, Na2CrO4 D Cr2O3, K2CrO4, Na2Cr2O7 Câu 28: Kết quả thí nghiệm dung dịch X, Y, Z, T với thuốc thử ghi bảng sau: Mẫu thử Thuốc thử Hiện tượng X Dung dịch AgNO3 NH3,t Kết tủa Ag Y Quỳ tím Chuyển màu xanh Z Cu(OH)2, nhiệt độ thường Màu xanh lam T Nước brom Kết tủa trắng Các dung dịch X, Y, Z, T là: A metanal, anilin, glucozơ, phenol B Etyl fomat, lysin, saccarozơ, anilin C glucozơ, alanin, lysin, phenol D axetilen, lysin, glucozơ, anilin Câu 29: Cho nhận xét sau: Trong điện phân dung dịch NaCl catot xẩy oxi hoá nước Khi nhúng Fe vào dung dịch hỗn hợp CuSO4 H2SO4 bản Fe bị ăn mòn điện hố Trong thực tế để loại bỏ NH3 phòng thí nghiệm ta phun khí Cl2 vào phòng Khi cho thêm CaCl2 vào nước cứng tạm thời thu nước cứng toàn phần Nguyên tắc để sản xuất gang khử quặng sắt oxit than cốc lò cao Sục H2S vào dung dịch hỗn hợp FeCl3 CuCl2 thu loại kết tủa Số nhận xét là: A B C D Trang 7/12 - Mã đề thi 689 Câu 30: Hỗn hợp X gồm metan, propen isopren Đốt cháy hồn tồn 15,0 gam X cần vừa đủ 36,96 lít O2 (đktc) Mặt khác, a mol X phản ứng tối đa với 0,1 mol brom Giá trị a A 0,20 B 0,15 C 0,30 D 0,10 HD CH4 + 2O2 a 2a C5H8 + 7O2 b 7b Ta có 16a+68b=15 2a+7b = 1,65 \a=0,3,b=0,15 Ta có 0,45mol hh + 0,3 mol Br2 Vậy 0,1 mol Br2 => số mol hh = 0,15 mol Câu 31: Cho từ từ dung dịch Ba(OH) vào dung dịch chứa a mol Al2(SO4)3 b mol AlCl3 khối lượng kết tủa sinh biểu diễn đồ thị sau Giá trị (x + y + a + b) gần với giá trị nhất sau đây? mkt (gam) 8,55 m số mol Ba(OH)2 0,08 x y A 0,0895 B 0,0845 C 0,0865 D 0,0755 HD Ta có 233.3a + 78.2a = 8,55 => a=0,01 => y= 0,03 mol Kết tủa max => Số mol OH- = 8a + 4b = 0,16 => b=0,02 mol Ta có 233x + 78.(2x/3) = 6,99 => x ≈ 0,0245 Câu 32: Cho chất sau: etan, poli etilen, axetilen, isopren, benzen, toluen, stiren, phenol, alanin, vinyl axetat Số chất tác dụng với nước brom điều kiện thường A B C D Câu 33: Điện phân (với điện cực trơ, màng ngăn xốp) dung dịch X chứa CuSO NaCl (có tỉ lệ mol tương ứng 1: 3) dòng điện mợt chiều có cường độ 2,68A, sau thời gian t thu dung dịch Y chứa hai chất tan thấy khối lượng dung dịch Y giảm 27,525 gam so với khối lượng dung dịch X Cho bột nhôm dư vào dung dịch Y, sau phản ứng xảy hoàn toàn thu 5,04 lít khí H2 (đktc) Giá trị t gần với A 5,5 B 4,5 C 5,0 D 6,5 HD Ta có nCuSO = ; BTE ⇒ 2nCu < nCl nNaCl ⟹ Nước bị điện phân bên catot trước tạo H2 Đặt nNaCl = 3nCuSO = 3a ; nH = b ; nO = c Trường hợp 1: Nước bị điện phân bên catot Al CuSO H 2O  NaOH + Na2SO4 → 5,04lit H ↑  →  2,68A  NaCl Cu ↓ +H ↑ +Cl ↓ = 27,525 BTE ⇒ nCl = 2nCu + 2nH = 3a = 2a + 2b BTE ⇒ nOH − = nA l = 2nH = 5,04.2 = 0,15 ⇒ b = 0,075 ⇒ a = 2b = 0,15 22,4.3 ⇒ mCu + mCl + mH = 0,15.64 + 0,15.3.35,5+ 0,15 = 25,725 ≠ 27,525 Trang 8/12 - Mã đề thi 689 Trường hợp 2: Nước bị điện phân cả điện cực Al CuSO H 2O  NaOH + Na2SO4 → 5,04lit H ↑  →   2,68A Cu ↓ +H ↑ +Cl ↓ +O ↓ = 27,525 NaCl    BTE :nCl + 4nO = 2nCu + 2nH ⇔ 3a + 4c = 2a + 2b a = 0,15 2    mCl + mO2 + mCu + mH = 35,5.3a + 32c + 64a + 2b = 27,525 ⇔  b = 0,175  c = 0,05 2nH 5,04.2   nOH − − nH + = nAlO 2− = 2b − 4c = nAl = = = 0,15 22,4.3  ⇒t= ( 0,15.2 + 0,175.2) 96500 ≈ 6,5 2,68.3600 ( h) Câu 34: X este mạch hở có công thức phân tử C5H8O2; Y Z hai este (đều no, mạch hở, tối đa hai nhóm este, MY < MZ) Đốt cháy hoàn toàn 0,2 mol hỗn hợp E gồm X, Y Z, thu 15,68 lít CO2 (đktc) Mặt khác, cho E tác dụng với dung dịch NaOH vừa đủ, thu hỗn hợp hai ancol có số cacbon hỗn hợp hai muối Phân tử khối Z A 74 B 118 C 88 D 132 HD t° Giải đốt 0,2 mol E + O2  → 0,7 mol CO2 + ? mol H2O ⇒ Ctrung bình E = 0,7 ÷ 0,2 = 3,5 ⇒ CY < 3,5 ⇒ có khả cho Y HCOOCH3; HCOOC2H5 CH3COOCH3 Tuy nhiên ý thủy phân E thu ancol có số C ⇒ Y phải HCOOC2H5 để suy ancol số C lại C2H4(OH)2 ⇒ cấu tạo X CH2=CH–COOC2H5 este Z no (HCOO)2C2H4 ⇒ MZ = 118 Câu 35: Cho m gam hỗn hợp X gồm Ba, BaO, Al vào nước thu 3,024 lít khí (đktc), dung dịch Y chất rắn không tan Z Cho tồn bợ Z vào dung dịch CuSO dư, kết thúc thí nghiệm thu dung dịch có khối lượng giảm 1,38 gam Cho từ từ 55 ml dung dịch HCl 2M vào Y thu 5,46 gam chất rắn Giá trị m A 8,20 gam B 7,21 gam C 8,58 gam D 8,74 gam HD Vì có thu chất rắn khơng tan Z Al ⟹ Trong dung dịch Y có Ba[Al(OH)4]2 2Al + 3Cu2+  → 2Al 3+ + 3Cu 2a 3a ⟹ 3a.64 – 2a.27 = 1,38 ⟹ a = 0,01 ⟹ nAl = 0,02 nHCl dùng = 0,055.2 = 0,11 mol mà nAl(OH)3 = 5,46/78 = 0,07 < 0,11 ⟹ Có phần Al(OH)3 bị hòa tan Ta đặt lượng Al(OH)3 tối đa tạo thành x ⟹ Lượng bị hòa tan x – 0,07 nH+ = lượng H+ để tạo Al(OH)3 tối đa + lượng H+ để hòa tan phần Al(OH)3 ⟹ 0,11 = x + (x – 0,07).3 ⟹ x = 0,08 ⟹ nBa[Al(OH)4]2 = 0,08/2 = 0,04  Ba  H 2O m gam X  BaO  → 0,02Al + 0,04 Ba[Al(OH)4]2 + 0,135H  Al  BTNT.Al ⟹ nAl = 0,02 + 0,04.2 = 0,1 Nhận thấy q trình hòa tan Al là: Al + OH- + 3H2O → Al(OH)4- + 1,5H2 Vậy ta có nH2 = nBa + 1,5nAl phản ứng ⟹ 0,135 = nBa + 1,5.0,08 ⟹ nBa = 0,015 ⟹ nBaO = 0,04 – 0,015 = 0,025 Trang 9/12 - Mã đề thi 689 ⟹ m = 0,015.137 + 0,025.153 + 0,1.27 = 8,58 Câu 36: Hỗn hợp X gồm mol amin no mạch hở A mol aminoaxit no mạch hở B tác dụng vừa đủ với mol HCl hay mol NaOH Đốt a gam hỗn hợp X cần 46,368 lít O (đktc) thu 8,064 lít khí N2 (đktc) Nếu cho a gam hỗn hợp tác dụng với dung dịch HCl dư thu gam muối? A 75,52 B 84,96 C 89,68 D 80,24 HD Theo đề nNaOH=n(−COOH)= 4nNaOH=n(−COOH)= => B có nhóm -COOH nHCl=nNH2 => A có nhóm -NH2 , B có nhóm -NH2 => A CnH2n+4N2; B CmH2m-1O4N Giả sử a gam hỗn hợp có x mol A 2x mol B CnH2n+4N2 + (3n+2)/2 O2 → CmH2m−1O4N + (6m−9)/4 O2 → N2 1/2N2 Ta có: x+122x=0,363n+22x+6m−942x=2,07 =>n+2m=10x+122x=0,363n+22x+6m−942x=2,07 =>n+2m=10 m muối = mX + mHCl = 0,18(14n + 32) + 0,36(14m + 77) + 0,72 × 36,5 = 84,96 g Câu 37: Hòa tan hồn tồn 216,55 gam hỗn hợp KHSO Fe(NO3)3 vào nước dung dịch X 64 m Y ) tan hết vào X Sau Cho m gam hỗn hợp Y gồm Mg, Al, MgO, Al 2O3 (trong đó m O = 205 phản ứng kết thúc, thu dung dịch Z chứa muối trung hòa 2,016 lít (đktc) hỗn hợp khí T có tổng khối lượng 1,84 gam (trong đó H chiếm 4/9 thể thích nguyên tố oxi chiếm 8/23 khối lượng hỗn hợp) Cho BaCl2 dư vào Z thu 356,49 gam kết tủa Giá trị m A 20,0 B 22,0 C 22,5 D 20,5 HD Hỗn hợp khí D gồm 0,04 mol H2 || mO/D = 0,64 gam ⇔ nO/D = 0,04 mol 1,84 − 0, 04 × − 0, 64 ⇒ nN/D = = 0,08 mol 14 Kết tủa BaSO4 với 1,53 mol → ban đầu có 1,53 mol KHSO4 → Fe(NO3)3 0,035 mol Bảo toàn N → Z có 0,025 mol NH4+; bảo toàn H → nH2O = 0,675 mol Bảo toàn O → ∑nO Y = 0,4 mol → m = 0,4 × 16 × 205 ÷ 64 = 20,5 gam K +  3+ 1,53mol  Al   64 48   Al    KHSO   2+  Mg  +   → Mg NO3 )   ? + ( O  Fe 43 Fe 123  0,035mol   mgam  NH +4 : 0, 025mol    mol   H : 0, 04     SO 42−  +  N : 0, 08mol  + H O { { O : 0, 04mol  0,675mol 1,53mol       Câu 38: Hỗn hợp E gồm pentapeptit X, hexapeptit Y, Val-Ala (trong X, Y chứa cả Ala, Gly, Val số mol Val-Ala 1/4 số mol hỗn hợp E) Cho 0,2 mol hỗn hợp E tác dụng vừa đủ với dung dịch chứa 0,95 mol NaOH, thu hỗn hợp muối Ala, Gly, Val Mặt khác đốt cháy hoàn toàn 139,3 gam E, thu tổng khối lượng CO H2O 331,1 gam Phần trăm khối lượng Y hỗn hợp E gần với giá trị sau đây? A 60% B 64% C 68% D 62% HD Trang 10/12 - Mã đề thi 689 Quy đổi E C₂H₃NO, CH₂ H₂O ⇒ nC₂H₃NO = nNaOH = 0,95 mol; nH₂O = nE = 0,2 mol Đặt nCH₂ = x Giả sử 139,3(g) E gấp k lần 0,2 mol E ⇒ 139,3(g) E chứa 0,95k mol C₂H₃NO; kx mol CH₂ 0,2k mol H₂O Đốt cho (1,9k + kx) mol CO₂ (1,625k + kx) mol H₂O ⇒ mE = 57 × 0,95k + 14kx + 18 × 0,2k = 139,3(g) Ta có 44.(1,9k + kx) + 18.(1,625k + kx) = 331,1(g) ⇒ giải hệ cho: k = 2; kx = 1,7 ⇒ x = 1,7 ÷ = 0,85 mol nVal-Ala = 1/4nE = 0,05 mol Đặt nX = a; nY = b ⇒ nE = a + b + 0,05 = 0,2 mol nC₂H₃NO = 5a + 6b + 0,05 × = 0,95 mol Giải hệ có: a = 0,05 mol; b = 0,1 mol Gọi số gốc CH₂ ghép vào X Y m n Chú ý X Y chứa cả Gly, Ala Val ⇒ X Y chứa nhất gốc Ala gốc Val ⇒ m, n ≥ (do ghép Ala cần CH₂; ghép Val cần CH₂) ⇒ 0,05m + 0,1n + 0,05 × = 0,85 Giải phương trình nghiệm nguyên: m = n = ⇒ X Gly2 Ala2Val Y Gly4AlaVal ⇒ %mY = 59,727% Câu 39: Hòa tan hồn tồn 13,12 gam hỗn hợp Cu, Fe Fe 2O3 240 gam dung dịch HNO 7,35% H2SO4 6,125% thu dung dịch X chứa 37,24 gam chất tan gồm muối thấy khí NO (NO sản phẩm khử nhất) Cho Ba(OH) dư vào dung dịch X, lấy kết tủa nung nóng không khí đến phản ứng hồn tồn thu 50,95 gam chất rắn Dung dịch X hòa tan tối đa m gam Cu Giá trị m A 2,56 B 2,88 C 3,20 D 3,52 HD Ta có nHNO3 = 240.0,0735 240.0,06125 = 0,28; nH 2SO = = 0,15 98 98 NO HNO 0,28 Cu2+ Cu +240gam  2+ NO −   H SO40,15   13,12gam Fe → X : Fe + H 2O 2−  SO Fe O  Fe3+    44 43 37,24gam nHNO − 2nH 2SO 0,28 + 0,3 = = 0,29 2 13,12 + 0,28.63 + 0,15.98 − 37,24 − 0,29.18 = 0,1 BTKL ⇒ nNO = 30 nCu = a nH 2O − 2nNO 0,29 − 0,2 = = 0,03 đặt  BTE ⇒ nFe2O = 3 nFe = b BTNT.H ⇒ nH 2O = BTKL ⇒ mCu + mFe + mFe2O3 = 64a + 56b + 0,03.160 = 13,12 Cu(OH)2 Cu2+ CuO  −  2+ NO  + Ba(OH ) Fe(OH)2 O2 , to  X : Fe → ↓  → 50,95gam Fe2O 2−  Fe(OH) Fe3+ SO     BaSO   BaSO  44 43 37,24gam ⇒ mCuO + mFe2O + mBaSO = 80a + 80b + 0,03.160 + 0,15.233 = 50,95 ⇒ a = 0,06; b = 0,08 Cu2+ Cu2+   2+ NO−3  + m gam Cu max Fe2+ X : Fe  → + H 2O − 2−  Fe3+ SO  NO  SO 2− 44 43  37,24gam Trang 11/12 - Mã đề thi 689 3nNO + 2nFe2O − 2nCu − 2nFe 3.0,1+ 0,03.2 − 2.0,06 − 2.0,08 = = 0,04 ⇒ mCu max = 0,04.64 = 2,56gam BTE ⇒ nCu max = Câu 40: Đốt cháy X Y với lượng oxi vừa đủ, thu CO có số mol số mol O2 phản ứng Biết X, Y (M X < MY) hai este mạch hở, không phân nhánh không chứa nhóm chức khác Đun nóng 30,24 gam hỗn hợp E chứa X, Y (số mol X gấp 1,5 lần số mol Y) cần dùng 400 ml dung dịch KOH 1M, thu hỗn hợp F chứa ancol hỗn hợp chứa muối Dẫn tồn bợ F qua bình đựng Na dư thấy khối lượng bình tăng 15,2 gam Đốt cháy hoàn toàn hỗn hợp muối cần dùng 0,42 mol O2 Tổng số nguyên tử có Y A 19 B 20 C 22 D 21 HD Bảo toàn gốc OH: nOH/ancol = nKOH = 0,4 mol Ta có -OH + Na → -ONa + 1/2H2↑ ⇒ nH2 = nOH ÷ = 0,2 mol Bảo tồn khối lượng: mF = 15,2 + 0,2 × = 15,6(g) Bảo tồn khối lượng: mmuối = 30,24 + 0,4 × 56 – 15,6 = 37,04(g) Bảo toàn nguyên tố Kali: nCOOK = nKOH = 0,4 mol; nK2CO3 = 0,2 mol Đặt nCO2 = x; nH2O = y Bảo toàn nguyên tố Oxi: 0,4 × + 0,42 × = 0,2 × + 2x + y Bảo tồn khối lượng: 37,04 + 0,42 × 32 = 0,2 × 138 + 44x + 18y Giải hệ có: x = 0,52 mol; y = mol ⇒ muối không chứa H ⇒ muối phải axit chức ⇒ X Y este chức ⇒ nX = 0,12 mol; nY = 0,08 mol Đặt số C gốc axit X Y a b 0,12a + 0,08b = 0,2 + 0,52 Giải phương trình nghiệm nguyên: a = b = ⇒ muối (COOK)2 KOOCC≡C-C≡CCOOK Mặt khác, đốt X hay Y cho nCO2 = nO2 ⇒ có dạng cacbohidrat Cn(H2O)m Lại có: X Y este chức ⇒ m = ⇒ X Y chứa 8H Do X Y mạch hở ⇒ ancol đơn chức ⇒ nF = nOH = 0,4 mol ⇒ MF = 39 ⇒ chứa CH3OH X CH3OOCCOOC2H5 Y CH3OOCC≡C-C≡CCOOC2H5 ⇒ Y chứa 21 nguyên tử - - HẾT - Trang 12/12 - Mã đề thi 689 ... C2H4, CO2 C N2, H2, NH3 D O2, CO2, C2H4 Câu 16: Phát biểu sau sai? A Thủy phân vinyl axetat thu andehit axetic B Etyl fomat có phản ứng tráng bạc C Triolein phản ứng với nước brom D Ở điều kiện... C2H4, CO2 C N2, H2, NH3 D O2, CO2, C2H4 Câu 16: Phát biểu sau sai? A Thủy phân vinyl axetat thu andehit axetic B Etyl fomat có phản ứng tráng bạc C Triolein phản ứng với nước brom D Ở điều kiện
- Xem thêm -

Xem thêm: De khao sat chat luong , De khao sat chat luong

Gợi ý tài liệu liên quan cho bạn

Nhận lời giải ngay chưa đến 10 phút Đăng bài tập ngay